Question #122381

The reaction of 2,4,6-trinitrotoluene (TNT) and oxygen is given by the equation: 4 C7H5(NO2)3(l) + 21O2(g) → 28 CO2(g) + 6 N2(g) + 10 H2O(g)

Assuming all gases are measured at SATP, what volume of carbon dioxide is formed when 10.0 L of oxygen gas is consumed?

Expert's answer

The balanced reaction equation of 2,4,6-trinitrotoluene (TNT) and oxygen is:

4 C7H5(NO2)3(l) + 21O2(g) → 28 CO2(g) + 6 N2(g) + 10 H2O(g).

As one can see, when 21 mol of oxygen is consumed, 28 mol of carbon dioxide is formed. Therefore, the number of the moles of oxygen reacted and carbon dioxide formed relate as:

21n(CO2)=28n(O2)21·n(CO_2) = 28·n(O_2) .

According to the ideal gas law (pV=nRTpV = nRT), at SATP conditions:

n(CO2)V(CO2)=n(O2)V(O2)\frac{n(CO_2)}{V(CO_2)} = \frac{n(O_2)}{V(O_2)} .

Making use of the number of the moles relation:

2821=V(CO2)V(O2)\frac{28}{21} = \frac{V(CO_2)}{V(O_2)}

V(CO2)=10(L)2821=13.3V(CO_2) = 10(L)·\frac{28}{21} = 13.3 L.

Answer: 13.3 L of carbon dioxide is formed when 10.0 L of oxygen gas is consumed.


Need a fast expert's response?

Submit order

and get a quick answer at the best price

for any assignment or question with DETAILED EXPLANATIONS!

LATEST TUTORIALS
APPROVED BY CLIENTS