Express 3 sin 4t + 8 cos 4t in the form R sin (ωt + α), α
Solution
Let 3 sin 4t + 8 cos 4t = R sin (ωt + α)
By using compound angle formula sin(A+B)=sinAcosB+cosAsinB we get to solve the following:
3 sin 4t + 8 cos 4t = R[ sin 4t cosα + cos4t sinα]
= (R cosα) sin 4t + (R sinα) cos4t
Equating the coefficients of:
sin 4t gives: 3 = R cosα, from which, cosα = R3
And cos 4t gives: 8 = R sinα, from which, sinα = R8
There is only one quadrant where both sinα and cosα are positive and is the first.
Hence: R = 32+82 = 8.544003745
from trigonometric ratios: α=arctan38 = 69.44395478 or 1.212025657 radians
Hence 3 sin 4t + 8 cos 4t = 8.544003745 sin(4t+1.212025657), 1.212025657
Answer: 8.544003745 sin(4t + 1.212025657), 1.212025657