Question #16684
Write a chemical equation for addition reactions to produce 3-hydroxy-3-methylhexane. Condensed structural formulas should be used for each organic compound.
Expert's answer
Markonikov's addition of water to olefins in presence of sulphuric acid might give this product:
CH3-CH2-CH2-C(CH3)=CH-CH3 + H2O -----> CH3-CH2-CH2-C(CH3)(OH)-CH2-CH3
3-methyl-2-hexene + H2O ----------> 3-hydroxy-3-methyl hexane
C7H14 + H2O ----------> C7H16O
CH3-CH2-CH2-C(CH3)=CH-CH3 + H2O -----> CH3-CH2-CH2-C(CH3)(OH)-CH2-CH3
3-methyl-2-hexene + H2O ----------> 3-hydroxy-3-methyl hexane
C7H14 + H2O ----------> C7H16O
Learn more about our help with Assignments: Inorganic Chemistry
