Question

Assuming that the initial concentrations of acetic acid and ethanol are both equal to 0.210 mol/L, calculate the final concentration of ethyl acetate at equilibrium.  The concentration of water should be included in the equilibrium expression. Keq is 4 for this reaction

Answer 1

$Kc = [CH3COOCH3][H2O]/[C2H5OH][CH3COOH] 4 = (x)(x)/(0.210-x)(0.210-x) x = 0.140 M Concentration of ethyl acetate = [0.140 M]$