K = [CH3COOC2H5]*[H2O]/([C2H5OH]*[CH3COOH]) ;
Let's suppose that the volume of the solution is 1 liter, then the initial amount of reactants is:
n(C2H5OH) = n(CH3COOH) = 0.81 mol;
If at equilibrium, the acetic acid concentration is 0.748 molL-1 , then the amount of the acid and alcohol respectively that reacted is:
n(CH3COOH)=n(C2H5OH)= 0.81-0.748=0.062 mol;
From the reaction we can understand that n(CH3COOH)=n(CH3COOC2H5)=n(H2O)=0.062 mol;
So, at equilibrium: [CH3COOC2H5]=[H2O]=0.062 mol/L;
[C2H5OH]=[CH3COOH]=0.748 mol/L;
K=(0.062*0.062)/(0.748*0.748) = 0.00687;
Answer: K for the reaction at 100oC is 0.00687