Question #79808

A coal sample consists of 82.1% carbon, 4.5% hydrogen, 1.5% sulphur, 3.0% oxygen and the remainder incombustible material. If 1 kg is burnt with 20% excess air, determine (i) the mass of air required per kilogram of fuel and (ii) prepare an analysis by mass of the products of combustion per kilogram of fuel.

Expert's answer

Answer on Question #79808, Physics / Molecular Physics | Thermodynamics

A coal sample consists of 82.1 % carbon, 4.5 % hydrogen, 1.5 % sulphur, 3.0% oxygen and the remainder incombustible material. If 1 kg is burnt with 20 % excess air, determine (i) the mass of air required per kilogram of fuel and (ii) prepare an analysis by mass of the products of combustion per kilogram of fuel.

Solution

Find masses of carbon, hydrogen, sulphur and oxygen in 1 kg of a coal.


m(C)=0.821×1000g=821gm(C) = 0.821 \times 1000 \, g = 821 \, gm(H)=0.045×1000g=45gm(H) = 0.045 \times 1000 \, g = 45 \, gm(S)=0.015×1000g=15gm(S) = 0.015 \times 1000 \, g = 15 \, gm(O)=0.030×1000g=30gm(O) = 0.030 \times 1000 \, g = 30 \, g


The reactions that take place in the process of burning:


C+O2CO2C + O_2 \rightarrow CO_24H+O22H2O4H + O_2 \rightarrow 2H_2OS+O2SO2S + O_2 \rightarrow SO_2


From the equation (1) we can see that mole ratio is n(C):n(O2):n(CO2)=1:1:1n(C) : n(O_2) : n(CO_2) = 1 : 1 : 1

Find amount of substance of carbon:


n=m/Mn = m / Mn(C)=821g12g/mol=68.4moln(C) = \frac{821 \, g}{12 \, g/mol} = 68.4 \, mol


Then n(O2)=68.4moln(O_2) = 68.4 \, mol

m(O2)=M(O2)×n(O2)=32g/mol×68.4mol=2188.8gm(O_2) = M(O_2) \times n(O_2) = 32 \, g/mol \times 68.4 \, mol = 2188.8 \, gn(CO2)=68.4moln(CO_2) = 68.4 \, molm(CO2)=M(CO2)×n(CO2)=44g/mol×68.4mol=3009.6gm(CO_2) = M(CO_2) \times n(CO_2) = 44 \, g/mol \times 68.4 \, mol = 3009.6 \, g


From the equation (2) we can see that mole ratio is n(H):n(O2):n(H2O)=4:1:2n(H) : n(O_2) : n(H_2O) = 4 : 1 : 2,

then n(O2)=n(H)/4n(O_2) = n(H)/4, n(H2O)=n(H)/2n(H_2O) = n(H)/2

Find n(H):n(H)=m(H)/M(H)=45g/1g/mol=45moln(H) : n(H) = m(H) / M(H) = 45 \, g / 1 \, g/mol = 45 \, mol

n(O2)=45mol/4=11.3moln(O_2) = 45 \, mol/4 = 11.3 \, molm(O2)=M(O2)×n(O2)=32g/mol×11.3mol=361.6gn(H2O)=45mol/2=22.5molm(H2O)=M(H2O)×n(H2O)=18g/mol×22.5mol=405g\begin{array}{l} m \left(O _ {2}\right) = M \left(O _ {2}\right) \times n \left(O _ {2}\right) = 3 2 g / m o l \times 1 1. 3 m o l = 3 6 1. 6 g \\ n \left(H _ {2} O\right) = 4 5 \mathrm {m o l} / 2 = 2 2. 5 \mathrm {m o l} \\ m \left(H _ {2} O\right) = M \left(H _ {2} O\right) \times n \left(H _ {2} O\right) = 1 8 g / m o l \times 2 2. 5 m o l = 4 0 5 g \\ \end{array}


From the equation (3) we can see that mole ratio is n(S):n(O2):n(SO2)=1:1:1n(S):n(O_2):n(SO_2) = 1:1:1

Find n(S):


n(S)=m(S)/M(S)=15g/32g/mol=0.469moln(O2)=0.469molm(O2)=32g/mol×0.469mol=15.0gn(SO2)=0.469molm(SO2)=M(SO2)×n(SO2)=64g/mol×0.469mol=30.0g\begin{array}{l} n (S) = m (S) / M (S) = 1 5 g / 3 2 g / m o l = 0. 4 6 9 m o l \\ n \left(O _ {2}\right) = 0. 4 6 9 \mathrm {m o l} \\ m \left(O _ {2}\right) = 3 2 g / m o l \times 0. 4 6 9 m o l = 1 5. 0 g \\ n \left(S O _ {2}\right) = 0. 4 6 9 \mathrm {m o l} \\ m \left(S O _ {2}\right) = M \left(S O _ {2}\right) \times n \left(S O _ {2}\right) = 6 4 g / m o l \times 0. 4 6 9 m o l = 3 0. 0 g \\ \end{array}


So, determine (i) the mass of air required per kilogram of fuel:

Find the mass of oxygen required for burning 1kg1\mathrm{kg} of coal


m(O2)=2188.8g+361.6g+15.0g=2565.4gm \left(O _ {2}\right) = 2 1 8 8. 8 g + 3 6 1. 6 g + 1 5. 0 g = 2 5 6 5. 4 g


The oxygen content of air by mass is 23%23\% .

Then mair=2565.4g/0.23=11153.9gm_{\text{air}} = 2565.4 \, \text{g} / 0.23 = 11153.9 \, \text{g}

As air was with 20%20\% excess then mair=11153.9+11153.9×0.2=13384.7g=13.4kg\mathsf{m}_{\mathrm{air}} = 11153.9 + 11153.9 \times 0.2 = 13384.7 \, \text{g} = 13.4 \, \text{kg}

(ii) an analysis by mass of the products of combustion per kilogram of fuel is



From the table data we can see that mass of CO2\mathrm{CO}_{2} formed is the bigger, the mass of H2O\mathrm{H}_{2} \mathrm{O} formed is 3009.6/405=7.43009.6 / 405 = 7.4 times less than the mass of CO2\mathrm{CO}_{2} , and the mass of SO2\mathrm{SO}_{2} is the minor (3009.6/30= 100 times less than the mass of CO2\mathrm{CO}_{2} )

Answer: (i) 13.4 kg

(ii)



From the table data we can see that mass of CO2\mathrm{CO}_{2} formed is the bigger, the mass of H2O\mathrm{H}_{2} \mathrm{O} formed is 3009.6/405=7.43009.6 / 405 = 7.4 times less than the mass of CO2\mathrm{CO}_{2} , and the mass of SO2\mathrm{SO}_{2} is the minor (3009.6/30= 100 times less than the mass of CO2\mathrm{CO}_{2} )

Answer provided by https://www.AssignmentExpert.com

LATEST TUTORIALS
APPROVED BY CLIENTS