Other Chemistry Answers

How many grams of solid will precipitate if 26.0 mL of 0.285 mol/L magnesium nitrate are combined with 32.0 mL of 0.265 mol/L potassium hydroxide?

If 15.0 mL of phosphoric acid completely neutralizes 38.5 mL of 0.150 mol/L calcium hydroxide, what is the concentration of the phosphoric acid?

oxidation and reduction reaction of 2 CuO(s) + C (s) → 2 Cu(s) + CO2 (g)

How many grams of Na₂SO₄ is needed to prepare a 2.0 L of 0.1 M Na₂SO₄?

Question 2 options:

A) 

28.2

B) 

7.05

C) 

56.4

D) 

14.1 

Silver sulfide and hydrogen gas combine to form silver and hydrogen sulfide. 3.0 g of H₂ and 100 g of Ag₂S are used to produce silver. The equation for the reaction is:

 Ag₂S + H₂ -> 2Ag + H₂S

Calculate the theoretical yield of silver? Your answer needs to explain what is the limiting reagent.

In the lab, 11.20 g of potassium hydroxide reacted with excess calcium chloride to produce 7.00 g of calcium hydroxide.

2KOH + CaCl₂ → 2KCl + Ca(OH)₂

a)   What is the actual yield of calcium hydroxide produced in the reaction?

All of your calculations need to be shown in order to get full marks on this question.

b)   What is the theoretical yield of calcium hydroxide based on the balanced equation for the reaction?

c)   What is the percentage yield of the reaction?

How many moles are there in 20.0 grams of Al₂(CO₃)₃

The standard heats of formation, delta Hf, fro C2H4 is +52.3KJ/mole. If C2H4 (ethylene) reacts with H2 to produce C2H6 (ethane) according to the following equation:

C2H4+H2=C2H6 deltaH=-137KJ

What is the heat of formation of C2H6?

Using a table of thermochemical data, calculate Enthalpy for the reaction.

CS2(g)+2H2O(l)=CO2(g)+2H2S(g)

Using a table of thermochemical data, calculate Enthalpy for the reaction.

CH4(g)+2O2(g)=CO2(g)+2H2O(g)