Learn more about our help with Assignments: Organic Chemistry
Search & Filtering
Organic Chemistry
What is the IUPAC name of ch3chclch(ch3)ch2ch2ch2ch2br?
Organic Chemistry
What are the examples, general formula, and functional group of ketone
Organic Chemistry
`Draw the structure of each of the following compounds
1.R-2-Iodopentane
2.ethyl-2-phenylpropanoate
3.N,N-dimethyl-4-bromohexanamide
4.Draw the structure of a chiral molecule,which contains a halogen atom.Draw the 3-dimensional structure of the 2 enantiomers of the compound and name each according to the Cahn-Ingold-Prelog rules
1.R-2-Iodopentane
2.ethyl-2-phenylpropanoate
3.N,N-dimethyl-4-bromohexanamide
4.Draw the structure of a chiral molecule,which contains a halogen atom.Draw the 3-dimensional structure of the 2 enantiomers of the compound and name each according to the Cahn-Ingold-Prelog rules
Organic Chemistry
13C NMR spectra for the starting stilbene and the
dibromostilbene. How could you use these to determine if the reaction you performed
has been successful, and can you tell which spectrum belongs to the product? Give
detailed reasons for your choice.
dibromostilbene. How could you use these to determine if the reaction you performed
has been successful, and can you tell which spectrum belongs to the product? Give
detailed reasons for your choice.
Organic Chemistry
What organic product would be formed from the reaction of 1-bromo-2-methylpropane (isobutyl bromide), (CH3)2CHCH2Br, with (CH3)3CO-, (CH3)3COH?
Organic Chemistry
a) Determine the mean molar mass of the atmosphere of Venus, which consists of 95% CO2 and 5% N2 by volume.
b) What is the corresponding gas constant?
c) The mean surface temperature T on Venus is a scorching 740K as compared to only 288K for Earth; the surface pressure is 90 times that on Earth. By what factor is the density of the near-surface Venusian atmosphere greater or less than that of Earth?
Organic Chemistry
Which compound in each pair is more water soluble? Which compound in each pair is more soluble in an organic solvent?
(a) CH3CH2CH2CH3 or CH3CH2CH2CH2CO2H
(b) CH3(CH2)4COOH or CH3(CH2)4COO–Na+.
(a) CH3CH2CH2CH3 or CH3CH2CH2CH2CO2H
(b) CH3(CH2)4COOH or CH3(CH2)4COO–Na+.
Organic Chemistry
What happens ph and acetic asid concentration when acetic acid is added to nadp dehydrogenation
Organic Chemistry
Show how you would accomplish the following conversions.
1.cis-hex-3-ene to (d,l)-hexane-3,4-diol
2.trans-hex-3-ene to meso-hexane-3,4-diol 3.trans-hex-3-ene to (d,l)-hexane-3,4-diol
1.cis-hex-3-ene to (d,l)-hexane-3,4-diol
2.trans-hex-3-ene to meso-hexane-3,4-diol 3.trans-hex-3-ene to (d,l)-hexane-3,4-diol
Organic Chemistry
What happens to pH and acectic acid concentration when acetic acid is added to Dehydrogenation of Glyceraldehyde 3-Phosphate?
