Organic Chemistry Answers

CH₃C(CH₃)₂CH₂CH=CHCH₂CH₃ what is the correct IUPAC name

What is the pH when 28.00 mL of 0.200 M potassium hydroxide (KOH) have been added to 50.00 mL of 0.100 M hydrochloric acid (HCl) solution?

1.      Which of the following alkyl halides would you expect to undergo SN1 reaction most rapidly? 

A   CH₃CH₂CH₂CH₂CH₂Br

B   CH₃CH₂CH₂CH(CH₃)Br

C   CH₃CH₂C(CH₃)₂Br

D   All of them reacts at the same rate.

1, Complete the following reactions

a, C6H5COCH3+CH3MgBr=

b, CH3CH2CH(CH3)CHO+CH3CH2NH2=

2, How many sigma bonds and pi bonds are in each of the following compounds

a, (CH3)2chCCCHCHCH3

b, CH3CH2CH3

c, H2CCHCH2CH3

Complete the following reactions

a, C6H5COCH3+CH3MgBr

HO-C-C-C-C-C-CH3 with a ketone coming off the second C and a CH3 coming one the fORTH carbon. What would I name that?

A bottle of a commercial reagent-grade hydrochloric acid, HCl has the following information on its label: Assay 37% HCl by mass; density 1.19 g/mL. Calculate the volume (mL) of concentrated HCl needed to prepare 250 mL of 0.1M HCl.

• Identify the incorrect statement regarding the synthesis of alkenes from alcohols.A. The reactions are dehydration reactions
• B. The tertiary alcohols always form at least two products
• C. Commonly used acid catalysts are H2SO4 and H3PO4
• D. The reactions are exothermic

You are working to earn enough money for a vacation which costs 1400.0 dollars. Your take-home pay is $16.50/hour, but you only work 4-hour shifts each day. How many days will it take for you to earn enough money to pay for your vacation if all the money you earn goes towards your vacation?

Convert ethoxy ethane to 2 mehoxy propane