Question #122738

1. 45cm3 of a solution containing 4g of impure potassium hydroxide in 250cm3 was neutralized by 25cm3 of 0.05M hydrochloric acid solution. Calculate
i. The concentration of the pure KOH in moles/dm3
ii. The percentage purity of KOH
iii. The percentage impurity of KOH
iv. The number of moles of hydroxyl ions present in the pure KOH that reacted

Expert's answer

The balanced reaction equation is:

KOH + HCl \rightarrow H2O + KCl.

As one can see, 1 mol of potassium hydroxide reacts with 1 mol of hydrochloric acid:

n(KOH)=n(HCl)n(KOH) = n(HCl) .

The number of the moles of HCl reacted is the product of the concentration and the volume of the HCl solution:

n(HCl)=cV=0.05(M)25103(L)=1.25103n(HCl) = cV = 0.05(M)·25·10^{-3}(L) = 1.25·10^{-3} mol.

Therefore, the number of the moles of KOH reacted is:

n(KOH)=n(HCl)=1.25103n(KOH) = n(HCl) = 1.25·10^{-3} mol.

The concentration of the 45 cm3 solution that contains 1.25·10-3 mol of KOH is:

c(KOH)=nV=1.25103(mol)45103(L)=0.028c(KOH) = \frac{n}{V} = \frac{1.25·10^{-3} (mol)}{45·10^{-3}(L)} = 0.028 M.

The mass of KOH in the solution is:

m=nM=1.25103(mol)56.11(g/mol)=0.070m = nM = 1.25·10^{-3} (mol)·56.11(g/mol) = 0.070 g.

The mass of KOH in 45 mL is proportional to the mass of KOH in 250 mL:

m145=m2250\frac{m_1}{45} =\frac{m_2}{250}

m2=m145250=0.07045250=0.39m_2 =\frac{m_1}{45}·250 = \frac{0.070}{45}·250 = 0.39 g.

The percentage purity of KOH is:

w=0.394100%=9.7w = \frac{0.39}{4} ·100\%=9.7 %.

The percentage impurity of KOH is:

wi=1009.7=90.3w_i = 100-9.7 = 90.3 %.

As KOH is a strong electrolyte, the number of the moles of hydroxide anions is equal to the number of the moles of KOH:

n(KOH)=n(OH)=1.25103n(KOH) = n(OH^-) = 1.25 ·10^{-3} mol.

Answer:

i. The concentration of the pure KOH is 0.028 moles/dm3

ii. The percentage purity of KOH is 9.7%

iii. The percentage impurity of KOH is 90.3 %

iv. The number of moles of hydroxyl ions present in the pure KOH that reacted is 1.25·10-3 mol.


P.S. I suppose that there is a mistake in the concentration of HCl used. If it was 0.5 M and not 0.05 M, the purity of KOH would be 97%, the percentage impurity would be 3%, the concentration of the pure KOH would be 0.28 moles/dm3 and the number of moles of hydroxyl ions present in the pure KOH that reacted would be 1.25·10-2 mol.


Need a fast expert's response?

Submit order

and get a quick answer at the best price

for any assignment or question with DETAILED EXPLANATIONS!

LATEST TUTORIALS
APPROVED BY CLIENTS