Question #79164

1. An experiment requires a solution that is 80% methyl alcohol by mass. What mass of methyl alcohol should be added to 20 g of water to make this solution?

2. Calculate the mole fraction of NaCl in a solution containing 12.6 g NaCl and 21.3 g KCl in 122 g of water.

3.A solution of phosphoric acid was made by dissolving 10.0 g of H3PO4 in 100.0 mL of water. The resulting volume was 104 mL. Calculate the molarity of the solution. Assume water has a density of 1.00 g/cm3.

Expert's answer

1) ω=m\omega = \mathrm{m} (substance) / m\mathrm{m} (solution) * 100%

m (solution) = m (substance) + m (solvent)

ω=m\omega = \mathrm{m} (substance) / m\mathrm{m} (substance) + m\mathrm{m} (solvent) * 100%

m (solvent) = m (H₂O) = 20 g

ω=80%\omega = 80\% or 0.8

m (substance) = m (methyl alcohol) = X


0.8=X/(X+20)0.8 = \mathrm{X} / (\mathrm{X} + 20)0.8∗X+16=X0.8 * \mathrm{X} + 16 = \mathrm{X}16=0.2∗X16 = 0.2 * \mathrm{X}X=80\mathrm{X} = 80


m (substance) = m (methyl alcohol) = 80 g

2) nNaCln_{\mathrm{NaCl}} – amount of NaCl = mNaCl/M(NaCl)=12.6 g/58.5 g/mole=0.215m_{\mathrm{NaCl}} / \mathrm{M}(\mathrm{NaCl}) = 12.6 \, \mathrm{g} / 58.5 \, \mathrm{g} / \mathrm{mole} = 0.215 moles

nKCln_{\mathrm{KCl}} – amount of KCl = mKCl/M(KCl)=21.3 g/74.5 g/mole=0.2859m_{\mathrm{KCl}} / \mathrm{M}(\mathrm{KCl}) = 21.3 \, \mathrm{g} / 74.5 \, \mathrm{g} / \mathrm{mole} = 0.2859 moles

nH2On_{\mathrm{H_2O}} – amount of H2O=mH2O/M(H2O)=122 g/18 g/mole=6.778\mathrm{H_2O} = \mathrm{m}_{\mathrm{H_2O}} / \mathrm{M}(\mathrm{H_2O}) = 122 \, \mathrm{g} / 18 \, \mathrm{g} / \mathrm{mole} = 6.778 moles

N – mole fraction of NaCl

ntotn_{\mathrm{tot}} – total amount of all constituents in a solution = nNaCl+nKCl+nH2O=0.215 moles+0.2859 moles+6.778 moles=7.2789 molesn_{\mathrm{NaCl}} + n_{\mathrm{KCl}} + n_{\mathrm{H_2O}} = 0.215 \, \mathrm{moles} + 0.2859 \, \mathrm{moles} + 6.778 \, \mathrm{moles} = 7.2789 \, \mathrm{moles}

N=nNaCl/(nNaCl+nKCl+nH2O)=0.215 moles/7.2789 moles=0.0295\mathrm{N} = \mathrm{n}_{\mathrm{NaCl}} / (\mathrm{n}_{\mathrm{NaCl}} + \mathrm{n}_{\mathrm{KCl}} + \mathrm{n}_{\mathrm{H_2O}}) = 0.215 \, \mathrm{moles} / 7.2789 \, \mathrm{moles} = 0.0295 or 2.95%2.95\%

3) M(H3PO4)=98 g/mole\mathrm{M}(\mathrm{H_3PO_4}) = 98 \, \mathrm{g} / \mathrm{mole}

n=m(H3PO4)/M(H3PO4)=10 g/98 g/mole=0.102 molesn = \mathrm{m}(\mathrm{H_3PO_4}) / \mathrm{M}(\mathrm{H_3PO_4}) = 10 \, \mathrm{g} / 98 \, \mathrm{g} / \mathrm{mole} = 0.102 \, \mathrm{moles}

V (solution) = 104 mL = 0.104 L

CM=nC_M = n (solute) / V (solution, L) = 0.102 moles / 0.104 L = 0.98 M


LATEST TUTORIALS
APPROVED BY CLIENTS