Use the thermochemical equations shown below to determine the enthalpy for the reaction:
C2H6O(l)+3O2(g)2CO2(g)+3H2O(l)
2C2H4O(l)+2H2O(l)2C2H6O(l)+O2(g) H= +203.5kJ 2CO2 (g)+2H2O(l)C2H4O(l)+5/2O2(g) H= +583.5kJ
We have to multiply the second equation by 2:
$2C_2H_4O+5O_2->4CO_2+4H_2O$
2C2H4O+5O2−>4CO2+4H2O
The enthalpy change for this reaction is multiplied by 2:
ΔH=-1167 kJ
We have to invert the first reaction and multiply it by 2:
$4CO_2+6H_2O->2C_2H_6O+6O_2$
4CO2+6H2O−>2C2H6O+6O2
The enthalpy change will then be multplied by -2:
ΔH=1371 kJ
Adding those two values of enthalpy change, we have the enthalpy change of the global reaction:
$2C_2H_4O+2H_2O->2C_2H_6O+O_2$
2C2H4O+2H2O−>2C2H6O+O2
Enthalpy change=-1167+1371=204 kJ