Question #68933

what is the total number of newtron in 10 gram of D2O?

Expert's answer

Answer on Question 68933, Physics, Atomic and Nuclear Physics

Question:

What is the total number of neutrons in 10 g of D2OD_2O?

Solution:

Let's first find the molar mass of the deuterium oxide:


MD2O=MD2+MO=2(2gmol1)+16gmol1=20gmol1.M_{D_2O} = M_{D_2} + M_O = 2 \cdot (2\,g \cdot mol^{-1}) + 16\,g \cdot mol^{-1} = 20\,g \cdot mol^{-1}.


Then, we can find the number of moles of deuterium oxide molecules in 10 g of D2OD_2O:


n=mD2OMD2O,n = \frac{m_{D_2O}}{M_{D_2O}},


here, mD2Om_{D_2O} is the mass of D2OD_2O, MD2OM_{D_2O} is the molar mass of the deuterium oxide.

Then, we get:


n=mD2OMD2O=10g20gmol1=0.5mol.n = \frac{m_{D_2O}}{M_{D_2O}} = \frac{10\,g}{20\,g \cdot mol^{-1}} = 0.5\,mol.


Also, we need to find the number of neutrons in one molecule of D2OD_2O:


Nn=Nn(D2)+Nn(O)=21n+8n=10n.N_n = N_n(D_2) + N_n(O) = 2 \cdot 1\,n + 8\,n = 10\,n.


Finally, we can find the total number of neutrons in 10 g of D2OD_2O:


Nn(total)=nNANn,N_{n(total)} = n \cdot N_A \cdot N_n,


here, NA=6.021023mol1N_A = 6.02 \cdot 10^{23}\,mol^{-1} is the Avogadro constant.

Then, we get:


Nn(total)=nNANn=0.5mol6.021023mol110neutrons==3.011024neutrons.\begin{array}{l} N_{n(total)} = n \cdot N_A \cdot N_n = 0.5\,mol \cdot 6.02 \cdot 10^{23}\,mol^{-1} \cdot 10\,neutrons = \\ = 3.01 \cdot 10^{24}\,neutrons. \end{array}


Answer:


Nn(total)=3.011024neutrons.N_{n(total)} = 3.01 \cdot 10^{24}\,neutrons.


Answer provided by https://www.AssignmentExpert.com

Need a fast expert's response?

Submit order

and get a quick answer at the best price

for any assignment or question with DETAILED EXPLANATIONS!

LATEST TUTORIALS
APPROVED BY CLIENTS