Question #99999

Consider a titration between 40.0 mL of .200 M HNO3 with .100 M NaOH. Calculate the pH at specific points given throughout the titration.
A. No NaOH added
B. 10.0 mL NaOH
c. 40.0 mL NaOH
D. 80.0 mL NaOH
E. 100.0 mL NaOH

Expert's answer

NaOH(aq)+HNO3(aq)=NaNO3(aq)+H2O(l)NaOH(aq)+ HNO_3(aq) =NaNO_3(aq) + H_2O(l)

A. No NaOH is added

c(H+)=c(HNO3)=0.200Mc(H^+)=c(HNO3) = 0.200 M

pH=log10[H+]=log10(0.200)=0.699pH = -log_{10}[H^+]=-log_{10}(0.200) = 0.699


B. 10 mL of NaOH are added

n(HNO3)=c×V=0.200×0.040=0.008moln(HNO3) = c\times V = 0.200\times0.040= 0.008 mol

n(NaOH)=c×V=0.100×0.010=0.001moln(NaOH) = c\times V = 0.100\times 0.010 = 0.001 mol

According to equation mole ratio n(NaOH):n(HNO3)=1:1n(NaOH):n(HNO3) = 1:1 , then moles of HNO3 used for reaction are n(HNO3)=n(NaOH)=0.001moln(HNO3) = n(NaOH) = 0.001 mol , moles left after titration are n(HNO3)left=0.0080.001=0.007moln(HNO_3)_{left} = 0.008-0.001 = 0.007 mol


c(H+)=nV=0.0070.04+0.01=0.14Mc(H^+)= \frac{n}{V} = \frac{0.007}{0.04+0.01} = 0.14 M


pH=log10(0.14)=0.854pH = -log_{10}(0.14) = 0.854


C. 40 .0 mL NaOH are added

n(HNO3)=0.008moln(HNO3) = 0.008 mol

n(NaOH)=c×V=0.1×0.04=0.004moln(NaOH) = c\times V = 0.1\times 0.04 = 0.004 mol

According to equation mole ratio n(NaOH):n(NaOH) , then moles of HNO3 used for reaction are n(HNO3) = n(NaOH) = 0.004 mol, moles left after titration are

n(HNO3)left=0.0080.004=0.004moln(HNO_3)_{left} = 0.008-0.004 = 0.004 mol

c(H+)=nV=0.0040.04+0.04=0.05Mc(H^+) = \frac{n}{V} = \frac{0.004}{0.04+0.04} = 0.05 M


pH=log10(0.05)=1.3pH = -log_{10}(0.05) = 1.3


D. 80 mL of NaOH are added

n(HNO3)=0.008moln(HNO3) = 0.008 mol

n(NaOH)=c×V=0.1×0.08=0.008moln(NaOH) = c\times V = 0.1\times 0.08=0.008 mol

According to equation mole ratio n(NaOH):n(NaOH)=1:1 , then moles of HNO3 used for reaction are n(HNO3) = n(NaOH) = 0.008 mol, moles left after titration are

n(HNO3)left=0.0080.008=0n(HNO_3)_{left} = 0.008-0.008 = 0

pH is determined by the H+H^+ ions produced by the water dissosiation

[H+]=1×107M[H^+] = 1\times 10^{-7} M


pH=log10(1×107)=7pH = -log_{10}(1\times10^{-7}) = 7


E. 100 mL of NaOH are added

n(HNO3)=0.008moln(HNO3) = 0.008 mol

n(NaOH)=0.1×0.1=0.01moln(NaOH) = 0.1\times 0.1 = 0.01 mol

Moles of NaOH left:

n(NaOH)left=0.010.008=0.002moln(NaOH)_{left} = 0.01-0.008 = 0.002 mol

n(OH)=n(NaOH)=0.002moln(OH^-) = n(NaOH) = 0.002 mol

c(OH)=nV=0.0020.04+0.1=0.0143Mc(OH^-) = \frac{n}{V} = \frac{0.002} {0.04+0.1} = 0.0143 M

pOH=log10[OH]=log10(0.0143)=1.845pOH = -log_{10}[OH^-] = -log_{10}(0.0143) = 1.845

As pH + pOH =14, then pH = 14-1.845 = 12.15


Need a fast expert's response?

Submit order

and get a quick answer at the best price

for any assignment or question with DETAILED EXPLANATIONS!

LATEST TUTORIALS
APPROVED BY CLIENTS