Question #80826

We heat 64.05 g of HgO and obtain 59.33 g of Hg and an O2 gas. what mass of gas do we get? what mass of HgO is necessary to obtain 35 g Hg?

Expert's answer

Answer on Question #80826 – Chemistry – Other

Task:

We heat 64.05 g of HgO and obtain 59.33 g of Hg and an O₂ gas. What mass of gas do we get? What mass of HgO is necessary to obtain 35 g Hg?

Solution:

Part 1:

Chemical reaction equation:


2HgO=2Hg+O22HgO = 2Hg + O_2


The law of conservation of mass or principle of mass conservation states that for any system closed to all transfers of matter and energy, the mass of the system must remain constant over time, as system's mass cannot change, so quantity cannot be added nor removed. Hence, the quantity of mass is conserved over time.

Then,


m(HgO)=m(Hg)+m(O2);m(O2)=m(HgO)m(Hg)=64.0559.33=4.72g\begin{array}{l} m(HgO) = m(Hg) + m(O_2); \\ m(O_2) = m(HgO) - m(Hg) = 64.05 - 59.33 = 4.72\,g \end{array}


Or:

by the equation of chemical reaction:


n(HgO)=n(Hg)=2n(O2)n(HgO) = n(Hg) = 2 \cdot n(O_2)Pr(Hg)=200.59g/mol;Pr(O2)=2Pr(O)=216=32g/mol;\Pr(Hg) = 200.59\,g/mol; \quad \Pr(O_2) = 2 \cdot \Pr(O) = 2 \cdot 16 = 32\,g/mol;Pr(HgO)=Pr(Hg)+Pr(O)=200.59+16=216.59g/mol\Pr(HgO) = \Pr(Hg) + \Pr(O) = 200.59 + 16 = 216.59\,g/moln(O2)=m(O2)M(O2)=m(HgO)2M(HgO)=m(Hg)2M(Hg);n(O_2) = \frac{m(O_2)}{M(O_2)} = \frac{m(HgO)}{2 \cdot M(HgO)} = \frac{m(Hg)}{2 \cdot M(Hg)};m(O2)=m(HgO)M(O2)2M(HgO)=m(Hg)M(O2)2M(Hg);m(O_2) = \frac{m(HgO) \cdot M(O_2)}{2 \cdot M(HgO)} = \frac{m(Hg) \cdot M(O_2)}{2 \cdot M(Hg)};


1) m(O2)=m(HgO)M(O2)2M(HgO)=64.05322216.59=4.73g;m(O_2) = \frac{m(HgO) \cdot M(O_2)}{2 \cdot M(HgO)} = \frac{64.05 \cdot 32}{2 \cdot 216.59} = 4.73\,g;

2) m(O2)=m(Hg)M(O2)2M(Hg)=59.33322200.59=4.73g.m(O_2) = \frac{m(Hg) \cdot M(O_2)}{2 \cdot M(Hg)} = \frac{59.33 \cdot 32}{2 \cdot 200.59} = 4.73\,g.

Part 2:


n(HgO)=n(Hg)n(HgO) = n(Hg)\Mr(Hg)=200.59 g/mol;\Mr(Hg) = 200.59\ g/mol;\Mr(HgO)=\Ar(Hg)+\Ar(O)=200.59+16=216.59 g/mol\Mr(HgO) = \Ar(Hg) + \Ar(O) = 200.59 + 16 = 216.59\ g/molm(HgO)M(HgO)=m(Hg)M(Hg);\frac{m(HgO)}{M(HgO)} = \frac{m(Hg)}{M(Hg)};m(HgO)=m(Hg)M(HgO)M(Hg);m(HgO) = \frac{m(Hg) * M(HgO)}{M(Hg)};m(HgO)=35216.59200.59=37.79 gm(HgO) = \frac{35 * 216.59}{200.59} = 37.79\ g


Answer: 1) 4.73 g of gas (O₂). 2) 37.79 g of HgO is necessary to obtain 35 g Hg

Answer provided by AssignmentExpert.com


Need a fast expert's response?

Submit order

and get a quick answer at the best price

for any assignment or question with DETAILED EXPLANATIONS!

LATEST TUTORIALS
APPROVED BY CLIENTS