Question #59815

Calculate the number of pounds of CO2 released into the atmosphere when a 21.0-gallon tank of gasoline is burned in an automobile engine. Assume that gasoline is primarily octane, C8H18, and that the density of gasoline is 0.692 g·mL–1 (this assumption ignores additives). Also assume complete combustion.

Expert's answer

Answer on the question #59815, Chemistry / Other

Question:

Calculate the number of pounds of CO2 released into the atmosphere when a 21.0-gallon tank of gasoline is burned in an automobile engine. Assume that gasoline is primarily octane, C8H18, and that the density of gasoline is 0.692 gmL10.692\ \mathrm{g}\cdot\mathrm{mL}^{-1} (this assumption ignores additives). Also assume complete combustion.

Solution:

Reaction equation of gasoline with oxygen is:


2C8H18+25O2=16CO2+18H2O2 C _ {8} H _ {1 8} + 2 5 O _ {2} = 1 6 C O _ {2} + 1 8 H _ {2} O


Then, number of the moles of octane and CO2CO_{2} relate as:


n(C8H18)=n(CO2)8n \left(C _ {8} H _ {1 8}\right) = \frac {n \left(C O _ {2}\right)}{8}


To calculate the number of the moles of octane, we divide its mass by the molar mass:


n(C8H18)=m(C8H18)M(C8H18)n \left(C _ {8} H _ {1 8}\right) = \frac {m \left(C _ {8} H _ {1 8}\right)}{M \left(C _ {8} H _ {1 8}\right)}m(C8H18)=Vρ=4.5521(L)0.692103(gL1)=6.612104gm \left(C _ {8} H _ {1 8}\right) = V \cdot \rho = 4. 5 5 \cdot 2 1 (L) \cdot 0. 6 9 2 \cdot 1 0 ^ {3} (g \cdot L ^ {- 1}) = 6. 6 1 2 \cdot 1 0 ^ {4} gn(C8H18)=6.612104g114.23gmol1=5.79102moln \left(C _ {8} H _ {1 8}\right) = \frac {6 . 6 1 2 \cdot 1 0 ^ {4} g}{1 1 4 . 2 3 g \cdot m o l ^ {- 1}} = 5. 7 9 \cdot 1 0 ^ {2} m o l


Then, mass of CO2CO_{2} is the product of its molar mass and number of the moles:


m(CO2)=n(CO2)M(CO2)=85.79102(mol)44.01(gmol1)=2.04105gm \left(C O _ {2}\right) = n \left(C O _ {2}\right) \cdot M \left(C O _ {2}\right) = 8 \cdot 5. 7 9 \cdot 1 0 ^ {2} (m o l) \cdot 4 4. 0 1 (g \cdot m o l ^ {- 1}) = 2. 0 4 \cdot 1 0 ^ {5} gm(CO2)=0.454(lbkg1)2.04102(kg)=92.5lbm \left(C O _ {2}\right) = 0. 4 5 4 (l b \cdot k g ^ {- 1}) \cdot 2. 0 4 \cdot 1 0 ^ {2} (k g) = 9 2. 5 l b


Answer: 92.5 lb

http://www.AssignmentExpert.com/


Need a fast expert's response?

Submit order

and get a quick answer at the best price

for any assignment or question with DETAILED EXPLANATIONS!

LATEST TUTORIALS
APPROVED BY CLIENTS