Question #48206

Aqueous sulfuric acid will react with solid sodium hydroxide to produce aqueous sodium sulfate and liquid water . Suppose 8.8 g of sulfuric acid is mixed with 6.48 g of sodium hydroxide. Calculate the maximum mass of water that could be produced by the chemical reaction. Be sure your answer has the correct number of significant digits.

Expert's answer

Answer on Question #48206 - Chemistry - Other

Question

Aqueous sulfuric acid will react with solid sodium hydroxide to produce aqueous sodium sulfate and liquid water. Suppose 8.8 g of sulfuric acid is mixed with 6.48 g of sodium hydroxide. Calculate the maximum mass of water that could be produced by the chemical reaction. Be sure your answer has the correct number of significant digits.

**Answer**: Balanced reaction equation is:


H2SO4(aq)+2NaOH(s)=Na2SO4(aq)+2H2O(l)\mathrm{H_2SO_4(aq)} + 2\mathrm{NaOH(s)} = \mathrm{Na_2SO_4(aq)} + 2\mathrm{H_2O(l)}


Molar masses of the reactants equal:


M(H2SO4)=98 g/mol,M(NaOH)=40 g/mol\mathrm{M(H_2SO_4)} = 98\ \mathrm{g/mol},\quad \mathrm{M(NaOH)} = 40\ \mathrm{g/mol}


Number of moles of the reactants are:


n(H2SO4)=m(H2SO4)M(H2SO4)=8.898=0.090 moln(H_2SO_4) = \frac{m(H_2SO_4)}{M(H_2SO_4)} = \frac{8.8}{98} = 0.090\ \mathrm{mol}n(NaOH)=m(NaOH)M(NaOH)=6.4840=0.16 moln(NaOH) = \frac{m(NaOH)}{M(NaOH)} = \frac{6.48}{40} = 0.16\ \mathrm{mol}


Then we make a proportion:

- 1 mole of H2SO4\mathrm{H_2SO_4} reacts with 2 moles of NaOH

- 0.090 moles of H2SO4x\mathrm{H_2SO_4} - x moles of NaOH


x=0.09021=0.18 moles of NaOH should react with 0.090 moles of H2SO4x = \frac{0.090 \cdot 2}{1} = 0.18\ \mathrm{moles}\ \text{of}\ \mathrm{NaOH}\ \text{should react with}\ 0.090\ \mathrm{moles}\ \text{of}\ \mathrm{H_2SO_4}


There are only 0.16 moles of sodium hydroxide, therefore it is the limiting reactant.

We need to make another proportion to calculate the maximum mass of H2O\mathrm{H_2O} that could be produced by the chemical reaction:

- 2 moles of NaOH produce 2 moles of H2O\mathrm{H_2O}

- 0.16 moles of NaOHx\mathrm{NaOH} - x moles of H2O\mathrm{H_2O}

x=0.1622=0.16 moles of H2O could be producedx = \frac{0.16 \cdot 2}{2} = 0.16\ \mathrm{moles}\ \text{of}\ \mathrm{H_2O}\ \text{could be produced}


The mass of H2O\mathrm{H_2O} equals:


m(H2O)=n(H2O)M(H2O)=0.1618=2.9 gm(H_2O) = n(H_2O) \cdot M(H_2O) = 0.16 \cdot 18 = 2.9\ \mathrm{g}


**Answer**: 2.9 g of H2O\mathrm{H_2O}

https://www.AssignmentExpert.com

Need a fast expert's response?

Submit order

and get a quick answer at the best price

for any assignment or question with DETAILED EXPLANATIONS!

LATEST TUTORIALS
APPROVED BY CLIENTS