Answer on Question #48206 - Chemistry - Other
Question
Aqueous sulfuric acid will react with solid sodium hydroxide to produce aqueous sodium sulfate and liquid water. Suppose 8.8 g of sulfuric acid is mixed with 6.48 g of sodium hydroxide. Calculate the maximum mass of water that could be produced by the chemical reaction. Be sure your answer has the correct number of significant digits.
**Answer**: Balanced reaction equation is:
H2SO4(aq)+2NaOH(s)=Na2SO4(aq)+2H2O(l)
Molar masses of the reactants equal:
M(H2SO4)=98 g/mol,M(NaOH)=40 g/mol
Number of moles of the reactants are:
n(H2SO4)=M(H2SO4)m(H2SO4)=988.8=0.090 moln(NaOH)=M(NaOH)m(NaOH)=406.48=0.16 mol
Then we make a proportion:
- 1 mole of H2SO4 reacts with 2 moles of NaOH
- 0.090 moles of H2SO4−x moles of NaOH
x=10.090⋅2=0.18 moles of NaOH should react with 0.090 moles of H2SO4
There are only 0.16 moles of sodium hydroxide, therefore it is the limiting reactant.
We need to make another proportion to calculate the maximum mass of H2O that could be produced by the chemical reaction:
- 2 moles of NaOH produce 2 moles of H2O
- 0.16 moles of NaOH−x moles of H2O
x=20.16⋅2=0.16 moles of H2O could be produced
The mass of H2O equals:
m(H2O)=n(H2O)⋅M(H2O)=0.16⋅18=2.9 g
**Answer**: 2.9 g of H2O
https://www.AssignmentExpert.com