Question #44170

how to calculate total number of atoms of the compound cuso4,5h2o

Expert's answer

Answer on Question #44170 - Chemistry - Other

Question:

How to calculate total number of atoms of the compound CuSO45H2O\mathrm{CuSO}_4\cdot 5\mathrm{H}_2\mathrm{O}.

Solution:

1. One molecular entity consists of one molecule of Copper (II) Sulphate and five molecules of water.

2. Copper (II) sulphate consists of: one atom of Copper, one atom of Sulfur and four atoms of Oxygen. To calculate the total number of atoms in molecule of Copper (II) Sulphate you should add the quantity of atoms for each element:


N(CuSO4)=N(Cu)+N(S)+N(O)=1+1+4=6 atomsN(\mathrm{CuSO}_4) = N(\mathrm{Cu}) + N(\mathrm{S}) + N(\mathrm{O}) = 1 + 1 + 4 = 6 \text{ atoms}


3. One molecule of water consists of one atom of Oxygen and two atoms of Hydrogen:


N(H2O)=N(H)+N(O)=2+1=3 atomsN(\mathrm{H}_2\mathrm{O}) = N(\mathrm{H}) + N(\mathrm{O}) = 2 + 1 = 3 \text{ atoms}


For five molecules of water that are in the composition of Copper (II) Sulphate, the total number of atoms is the following:


N(5H2O)=5N(H2O)=53=15 atomsN(5\mathrm{H}_2\mathrm{O}) = 5 \cdot N(\mathrm{H}_2\mathrm{O}) = 5 \cdot 3 = 15 \text{ atoms}


4. The total number of atoms in one molecule is the following:


N(CuSO45H2O)=N(CuSO4)+N(5H2O)=6+15=21 atomsN(\mathrm{CuSO}_4 \cdot 5\mathrm{H}_2\mathrm{O}) = N(\mathrm{CuSO}_4) + N(5\mathrm{H}_2\mathrm{O}) = 6 + 15 = 21 \text{ atoms}

Answer: The total number of atoms of the compound $\mathrm{CuSO}_4\cdot 5\mathrm{H}_2\mathrm{O}$ is 21 atoms.

http://www.AssignmentExpert.com/


Need a fast expert's response?

Submit order

and get a quick answer at the best price

for any assignment or question with DETAILED EXPLANATIONS!

LATEST TUTORIALS
APPROVED BY CLIENTS