Answer on Question #43895 - Chemistry - Other
Question:
Calculate the heat when 150ml of .500 M HCl is mixed with 450ml of .100 M barium hydroxide. Assuming the temperature of both solutions was initially 25∘C and that the final mixture has a mass of 600g and specific heat if water, calculate the final temperature of the mixture?
ci(Ba(OH)2)=0.100LmolV(Ba(OH)2)=450.0mLci(HCl)=0.500LmolV(HCl)=150.0mLm(s o l u t i o n)=600.0gt1(HCl)=t1(Ba(OH)2)=25∘CcP(H2O)=4.1813g⋅KJt2(s o l u t i o n)−?Solution:
1. Write the reaction as a molecular equation:
Ba(OH)2(aq)+2HCl(aq)→BaCl2(aq)+2H2O(l)
2. Then the overall ionic equation for the reaction:
Ba(aq)2++2OH(aq)−+2H(aq)++2Cl(aq)−→Ba(aq)2++2Cl(aq)−+2H2O(l)
3. The net ionic equation for the reaction:
2H(aq)++2OH(aq)−→2H2O(l)
4. When we mix strong acid with strong base, we obtain the heat from the reaction of water synthesis. The standard enthalpy of neutralization for such reaction is constant ΔHN⊖=−56000molJ . This value shows us the change of enthalpy during water synthesis. We can calculate the heat released from such reaction by the equation:
Q=−ni(H2O)ΔHN⊖
5. The amount of water can be found from the equation:
ni(H2O)=ni(HCl)=2ni(Ba(OH)2)
6. We compare the amount of acid and base and find that the base is in excess:
ni(Ba(OH)2)=ci(Ba(OH)2)⋅V(Ba(OH)2)=0.100Lmol⋅1000450.0mL=0.045molni(HCl)=ci(HCl)⋅V(HCl)=0.500Lmol⋅1000150.0mL=0.075mol
The stoichiometric ratio ni(HCl)ni(Ba(OH)2) is 1:2, so for full acid neutralization we need to have
ni(Ba(OH)2)=2ni(HCl)=20.075mol=0.0375mol
The stoichiometric ratio ni(H2O)ni(HCl) is 1:1, so
ni(H2O)=ni(HCl)=0.075mol
7. Find heat released after reaction:
Q=−ΔHN⊖⋅ni(H2O)=−(−56000)molJ⋅0.075mol=4200.0J
8. Then we can calculate the temperature difference after the reaction:
Q=cP(H2O)⋅m(H2O)⋅ΔTΔT=cP(H2O)⋅m(H2O)Q=600g⋅4.1813g⋅KJ4200.0J=1.67KΔT=Δt=1.67∘C
9. Find the final temperature of the mixture:
Δt=t2(s o l u t i o n)−t1(HCl)t2(s o l u t i o n)=Δt+t1(HCl)=25∘C+1.67∘C=26.67∘C
Answer: The final temperature of the mixture is 26.67∘C.
http://www.AssignmentExpert.com/