Question #43895

Calculate the heat when 150 ml of .500 M HCI is mixed with450 ml of .100 M barium hydroxide. Assuming the temperature of both solutions was initially 25℃ and that the final mixture has a mass of 600 g and specific heat if water, calculate the final temperature of the mixture?

Expert's answer

Answer on Question #43895 - Chemistry - Other

Question:

Calculate the heat when 150ml150\mathrm{ml} of .500 M HCl is mixed with 450ml450\mathrm{ml} of .100 M barium hydroxide. Assuming the temperature of both solutions was initially 25C25^{\circ}\mathrm{C} and that the final mixture has a mass of 600g600\mathrm{g} and specific heat if water, calculate the final temperature of the mixture?


ci(Ba(OH)2)=0.100molLc _ {i} (\mathrm {B a} (\mathrm {O H}) _ {2}) = 0. 1 0 0 \frac {m o l}{L}V(Ba(OH)2)=450.0mLV (\mathrm {B a} (\mathrm {O H}) _ {2}) = 4 5 0. 0 m Lci(HCl)=0.500molLc _ {i} (\mathrm {H C l}) = 0. 5 0 0 \frac {m o l}{L}V(HCl)=150.0mLV (\mathrm {H C l}) = 1 5 0. 0 m Lm(s o l u t i o n)=600.0gm (\text {s o l u t i o n}) = 6 0 0. 0 gt1(HCl)=t1(Ba(OH)2)=25Ct _ {1} (\mathrm {H C l}) = t _ {1} (\mathrm {B a} (\mathrm {O H}) _ {2}) = 2 5 ^ {\circ} \mathrm {C}cP(H2O)=4.1813JgKc _ {\mathrm {P}} \left(\mathrm {H} _ {2} \mathrm {O}\right) = 4. 1 8 1 3 \frac {J}{g \cdot K}t2(s o l u t i o n)?t _ {2} (\text {s o l u t i o n}) -?

Solution:

1. Write the reaction as a molecular equation:


Ba(OH)2(aq)+2HCl(aq)BaCl2(aq)+2H2O(l)\mathrm {B a} (\mathrm {O H}) _ {2} (\mathrm {a q}) + 2 \mathrm {H C l} _ {(\mathrm {a q})} \rightarrow \mathrm {B a C l} _ {2} (\mathrm {a q}) + 2 \mathrm {H} _ {2} \mathrm {O} _ {(\mathrm {l})}


2. Then the overall ionic equation for the reaction:


Ba(aq)2++2OH(aq)+2H(aq)++2Cl(aq)Ba(aq)2++2Cl(aq)+2H2O(l)\mathrm {B a} _ {\mathrm {(a q)}} ^ {2 +} + 2 \mathrm {O H} _ {\mathrm {(a q)}} ^ {-} + 2 \mathrm {H} _ {\mathrm {(a q)}} ^ {+} + 2 \mathrm {C l} _ {\mathrm {(a q)}} ^ {-} \rightarrow \mathrm {B a} _ {\mathrm {(a q)}} ^ {2 +} + 2 \mathrm {C l} _ {\mathrm {(a q)}} ^ {-} + 2 \mathrm {H} _ {2} \mathrm {O} _ {\mathrm {(l)}}


3. The net ionic equation for the reaction:


2H(aq)++2OH(aq)2H2O(l)2 \mathrm {H} _ {\mathrm {(a q)}} ^ {+} + 2 \mathrm {O H} _ {\mathrm {(a q)}} ^ {-} \rightarrow 2 \mathrm {H} _ {2} \mathrm {O} _ {\mathrm {(l)}}


4. When we mix strong acid with strong base, we obtain the heat from the reaction of water synthesis. The standard enthalpy of neutralization for such reaction is constant ΔHN=56000Jmol\Delta H_{\mathrm{N}}^{\ominus} = -56000\frac{J}{mol} . This value shows us the change of enthalpy during water synthesis. We can calculate the heat released from such reaction by the equation:


Q=ΔHNni(H2O)Q = - \frac {\Delta H _ {N} ^ {\ominus}}{n _ {i} (\mathrm {H} _ {2} \mathrm {O})}


5. The amount of water can be found from the equation:


ni(H2O)=ni(HCl)=ni(Ba(OH)2)2n _ {i} (\mathrm {H} _ {2} \mathrm {O}) = n _ {i} (\mathrm {H C l}) = \frac {n _ {i} (\mathrm {B a} (\mathrm {O H}) _ {2})}{2}


6. We compare the amount of acid and base and find that the base is in excess:


ni(Ba(OH)2)=ci(Ba(OH)2)V(Ba(OH)2)=0.100molL450.0mL1000=0.045moln _ {i} (\mathrm {B a (O H)} _ {2}) = c _ {i} (\mathrm {B a (O H)} _ {2}) \cdot V (\mathrm {B a (O H)} _ {2}) = 0.100 \frac {m o l}{L} \cdot \frac {450.0 \, mL}{1000} = 0.045 \, m o lni(HCl)=ci(HCl)V(HCl)=0.500molL150.0mL1000=0.075moln _ {i} (\mathrm {H C l}) = c _ {i} (\mathrm {H C l}) \cdot V (\mathrm {H C l}) = 0.500 \frac {m o l}{L} \cdot \frac {150.0 \, mL}{1000} = 0.075 \, m o l


The stoichiometric ratio ni(Ba(OH)2)ni(HCl)\frac{n_i(\mathrm{Ba(OH)}_2)}{n_i(\mathrm{HCl})} is 1:21:2, so for full acid neutralization we need to have


ni(Ba(OH)2)=ni(HCl)2=0.075mol2=0.0375moln _ {i} (\mathrm {B a (O H)} _ {2}) = \frac {n _ {i} (\mathrm {H C l})}{2} = \frac {0.075 \, m o l}{2} = 0.0375 \, m o l


The stoichiometric ratio ni(HCl)ni(H2O)\frac{n_i(\mathrm{HCl})}{n_i(\mathrm{H}_2\mathrm{O})} is 1:11:1, so


ni(H2O)=ni(HCl)=0.075moln _ {i} (\mathrm {H} _ {2} \mathrm {O}) = n _ {i} (\mathrm {H C l}) = 0.075 \, m o l


7. Find heat released after reaction:


Q=ΔHNni(H2O)=(56000)Jmol0.075mol=4200.0JQ = - \Delta H _ {N} ^ {\ominus} \cdot n _ {i} (\mathrm {H} _ {2} \mathrm {O}) = - (- 56000) \frac {J}{m o l} \cdot 0.075 \, m o l = 4200.0 \, J


8. Then we can calculate the temperature difference after the reaction:


Q=cP(H2O)m(H2O)ΔTQ = c _ {\mathrm {P}} (\mathrm {H} _ {2} \mathrm {O}) \cdot m (\mathrm {H} _ {2} \mathrm {O}) \cdot \Delta TΔT=QcP(H2O)m(H2O)=4200.0J600g4.1813JgK=1.67K\Delta T = \frac {Q}{c _ {\mathrm {P}} (\mathrm {H} _ {2} \mathrm {O}) \cdot m (\mathrm {H} _ {2} \mathrm {O})} = \frac {4200.0 \, J}{600 \, g \cdot 4.1813 \, \frac {J}{g \cdot K}} = 1.67 \, KΔT=Δt=1.67C\Delta T = \Delta t = 1.67^{\circ} \mathrm{C}


9. Find the final temperature of the mixture:


Δt=t2(s o l u t i o n)t1(HCl)\Delta t = t _ {2} (\text {s o l u t i o n}) - t _ {1} (\mathrm {H C l})t2(s o l u t i o n)=Δt+t1(HCl)=25C+1.67C=26.67Ct _ {2} (\text {s o l u t i o n}) = \Delta t + t _ {1} (\mathrm {H C l}) = 25^{\circ} \mathrm{C} + 1.67^{\circ} \mathrm{C} = 26.67^{\circ} \mathrm{C}


Answer: The final temperature of the mixture is 26.67C26.67^{\circ}\mathrm{C}.

http://www.AssignmentExpert.com/


Need a fast expert's response?

Submit order

and get a quick answer at the best price

for any assignment or question with DETAILED EXPLANATIONS!

LATEST TUTORIALS
APPROVED BY CLIENTS