How do you find percentage yield? For example, reacting 991 mol of SiO(subscript2) with excess carbon yield 30.0 kg of SiC.
Solution:
Write the equation for the reaction:
SiO2+3C=SiC+2CO
In chemistry, the reaction yield is the amount of product produced by a chemical reaction. The theoretical yield is the maximum amount of product that can be produced in a perfectly balanced reaction, but the actual yield is usually less than the theoretical yield. To express the efficiency of a reaction, calculate the percent yield using this formula:
%yield=m(SiC)theoreticalm(SiC)actual∗100%
By the reaction equation we find the amount of substance of SiC:
n(SiC)n(SiO2)=11n(SiC)=n(SiO2)∗1=991∗1=991 mole
Find the mass of SiC, which can theoretically be formed:
m(SiC)theoretical=n(SiC)∗M(SiC)m(SiC)theoretical=991 mole∗40.096moleg=39735.3g=39.7353 kg
Calculate the percent yield of SiC:
%yield=39.7353 kg30.0 kg∗100%=75.5%
Answer: percent yield of SiC 75.5%