20mL of Al(OH)3 reacts completely with 50mL of 1mol of HBr. What is the concentration of Al(OH)3?
Solution:
We write the equation for the reaction:
Al(OH)3+3HBr=AlBr3+3H2OM(Al(OH)3)=v(Al(OH)3)n(Al(OH)3)=lmoleM−concentration of the substance
Convert your mL solutions to L in order to plug them into formula.
v((Al(OH)3))=20ml×1000ml1l=0.020lv(HBr)=50ml×1000ml1l=0.050l
Find the amount of the substance HBr, which came in response:
n(HBr)=V(HBr)×M(HBr)n(HBr)=1×0.050=0.05 mole
According to the reaction equation we find the amount of the substance Al(OH)3:
n(HBr)n(Al(OH)3)=31n(Al(OH)3)=3n(HBr)=30.05=0.017 mole
Find the concentration of Al(OH)3:
M(Al(OH)3)=0.020 l0.017 mole=0.85
Answer: 0.85 M (Al(OH)3)