Question #136023
A sample containing ammonium chloride was warmed with 100 mL of 1.00 moldm-3 sodium
hydroxide. After all the ammonia had been driven off, the excess sodium hydroxide required
50.00 mL of 0.250 moldm-3 sulfuric acid for neutralisation. What mass of ammonium chloride did
the sample contain?
1
Expert's answer
2020-09-30T07:56:18-0400

When the ammonium chloride reacts with sodium hydroxide, ammonia, sodium chloride and water are formed:

NH4Cl + NaOH \rightarrow NH3\uparrow + NaCl + H2O.

Then, the sulfuric acid reacts with the excess sodium hydroxide to form sodium sulphate and water:

2NaOH + H2SO4\rightarrow Na2SO4 + 2H2O.

As one can see, 2 mol of sodium hydroxide react with 1 mol of sulfuric acid:

n(NaOH)2=n(H2SO4)\frac{n(NaOH)}{2} = n(H_2SO_4) .

The number of the moles of the sulfuric acid can be calculated from its volume and its concentration:

n(H2SO4)=cV=0.250 mol/dm350103 dm3n(H_2SO_4) = cV = 0.250\text{ mol/dm}^3 \cdot50\cdot10^{-3}\text{ dm}^3

n(H2SO4)=0.0125n(H_2SO_4) = 0.0125 mol.

Therefore, the number of the moles of the excess sodium hydroxide was:

n(NaOH)=20.0125=0.025n(NaOH) = 2\cdot0.0125 = 0.025 mol.

The number of the moles of sodium hydroxide reacted with ammonium chloride can be calculated from the total number of the moles of sodium hydroxide added (cV=1.00 mol/dm3100103 dm3=0.1cV = 1.00\text{ mol/dm}^3 \cdot100\cdot10^{-3}\text{ dm}^3 = 0.1 mol) minus the number of the moles of the excess sodium hydroxide:

n(NaOH)NH4Cl=0.10.025=0.075n(NaOH)_{NH_4Cl} = 0.1 - 0.025 = 0.075 mol.

According to the stoichiometry of the first reaction, the number of the moles of the ammonium chloride is:

n(NH4Cl)=n(NaOH)=0.075n(NH_4Cl) = n(NaOH) = 0.075 mol.

Finally, the mass of the sample of the ammonium chloride can be calculated using its molar mass MM =53.49 g/mol:

m(NH4Cl)=nM=0.075 mol53.49 g/molm(NH_4Cl) = nM = 0.075 \text{ mol}\cdot 53.49 \text{ g/mol}

m(NH4Cl)=4.012 gm(NH_4Cl) =4.012 \text{ g} .

Answer: the sample contained 4.012 g of ammonium chloride .


Need a fast expert's response?

Submit order

and get a quick answer at the best price

for any assignment or question with DETAILED EXPLANATIONS!

Comments

No comments. Be the first!
LATEST TUTORIALS
APPROVED BY CLIENTS