Question #128153

H2C2O4 + 2NaOH -> Na2C2O4 + 2H2O


if n(H2C2O4*2H2O) = 6.44*10-6, what is the amount of NaOH in moles?


Expert's answer

H2C2O4 + 2NaOH \rightarrow  Na2C2O4 + 2H2O

According to the stoichiometry of the reaction, the number of the moles of the oxalic acid relates to the number of the moles of sodium hydroxide as:

n(H2C2O4)=n(NaOH)2n(H_2C_2O_4) = \frac{n(NaOH)}{2} .

The number of the moles of H2C2O4 equals the number of the moles of H2C2O4*2H2O, as there is one molecule of oxalic acid per hydrate unit.

Therefore, if n(H2C2O42H2O)=6.44106n(H_2C_2O_4*2H_2O) = 6.44·10^{-6} mol, the amount of NaOH in moles is n(NaOH)=2n(H2C2O42H2O)=1.29105n(NaOH) = 2·n(H_2C_2O_4*2H_2O) = 1.29·10^{-5} mol.


Need a fast expert's response?

Submit order

and get a quick answer at the best price

for any assignment or question with DETAILED EXPLANATIONS!

LATEST TUTORIALS
APPROVED BY CLIENTS