Question #114959

Suppose 2.17 mol of HCl is dissolved in enough water to give 504.5 mL of solution.

What is the H3O+ concentration?

What is the pH?

Expert's answer

HCl is a strong electrolyte: it means that the dissociation is nearly complete in water solution (pKa=-9.3, or Ka=109.3). The reaction of dissociation of HCl in water is:

HCl + H2O \rightarrow H3O+ + Cl-.

As you can see, one mole of HCl gives one mole of the H3O+ ions. Therefore, the concentration of H3O+ is equal to the concentration of HCl:

c(H3O+)=c(HCl)=2.17504.5103=4.30c(H_3O^+) = c(HCl) = \frac{2.17}{504.5·10^{-3}} = 4.30 mol/L, or M.

The pH is defined as -log(c(H+)):

pH=log([H3O+])=log(4.30)=0.63pH = -log([H_3O^+]) = -log(4.30) = -0.63 .

Don't worry about the negative pH. The misconception that pH lies between 0 and 14 is disclaimed in literature[1].


[1] : Kieran F. Lim, Journal of Chemical Education 2006 83 (10), 1465, DOI: 10.1021/ed083p1465

Answer: the concentration of H3O+ is 4.30 M. The pH is -0.63.


Need a fast expert's response?

Submit order

and get a quick answer at the best price

for any assignment or question with DETAILED EXPLANATIONS!

LATEST TUTORIALS
APPROVED BY CLIENTS