Organic Chemistry Answers

Questions: 5 321

Answers by our Experts: 5 018

Need a fast expert's response?

Submit order

and get a quick answer at the best price

for any assignment or question with DETAILED EXPLANATIONS!

Search & Filtering

What IR absorptions are most affected by intramolecular hydrogen bonding in the compound

shown below?

Methyl group C-H stretching

b) Hydroxyl group O-H stretching

c) Aromatic ring C-H bending

d) Aromatic ring C-H stretching

d) Aromatic ring C-C stretching



What is the mechanism of the following reaction

CH2=CH(CH3)-CH2-CH3 + BF3.MeOH + MeOH   →    CH3-C(CH3)(O-CH3)-CH2-CH3

Could you please send it to me. Thank you



Deduce the structure of a disaccharide from the following information:

I. Complete hydrolysis yield only D-glucose. It is hydrolyzed by only α-glucosidase, but not β-glucosidase

II. It does not reduce Cu2+ to Cu2O


Draw the structure of the disaccharide isomaltose, given the following information:

I. It is composed of 2 D-glucose units.

II. The glycosidic bond is α(1->6)

III. The anomeric carbon not involved in the glycosidic bond is in the β configuration


Enzyme acts as catalytic agent by certain mechanism. What is the main idea
of acid-base catalysis?
Why does the Lugol’s test (iodine test) give dark blue color of amylase- starch
mixture after boiling of this mixture?

Which of the following molecules have a dipole moment?

a. H2O

b. CO2

c. SO2

d. CH4


Write the condensed structural formula of:

(a) 3-methy-2-octene

(b) 1,3,5 -decatriene

(c) 3-nonyne


Why is ethene an unsaturated hydrocarbon

Draw the line-angle formula of the straight-chain (no carbon side chain) positional isomers of (a) CH 3 CH ═ CHCH 2 CH 2 CH 2 CH 3 (b) CH 3 C≡CCH 2 CH 2 CH 3 and give the corresponding IUPAC name.