Organic Chemistry Answers

Questions: 5 321

Answers by our Experts: 5 018

Need a fast expert's response?

Submit order

and get a quick answer at the best price

for any assignment or question with DETAILED EXPLANATIONS!

Search & Filtering

(a) Write the IUPAC names of the following structures:

(i) 1,3-dimethoxybicyclo[2.2.1]heptane                                                                        

(ii) bicyclo[2.2.1]hept-5-en-2-one                                                           


Two stereoisomers of 1-tert-butyl-2-bromo-3-methylcyclohexane are shown below. These are referred to in the questions that follow.




(a) Draw the possible chair conformers for each of the above stereoisomers and indicate the more stable conformer in each pair by calculating total strain energy. [4 marks]


(b) Perform the ring flip for the most stable conformer for each structure and comment using relative energies of the chair conformations suggesting which form is more stable. [4 marks]


(c) If each stereoisomer is exposed to E2 elimination conditions, draw the structure(s) of the E2 elimination product(s) that may be obtained for each of them. Show clearly how you arrive at the answers (use mechanisms). [4 marks]


If the complete combustion of 1 mole of an alkanol is represented by the equation CnH2n+1 OH + XO2 --------- y CO2 + zH2O, then which of the following is or are correct
1.x=n
2.y=3n/2
3.x+y =5n/2
4.y+z = 2n +1 *

one modern instrumental methodology that can be used to determine the functional groups of a compound without using the qualitative tests


How many molecules of oxygen are there in a 1.00 g sample of O2? (Avogadro constant, L = 6.02 × 1023 mol–1)


Draw isomers of cyclobutane

 What are the names of the following structures based on the IUPAC system.

1. CH3CºCCH2CH3

2. (CH3)2CHCºCC(CH3)3

3. CH3CH(C3H5)CH=CHCH(CH2CH2CH3)CH2CH2CH3

4. CH3CH2C(CH2CH3)=CHCH(CH2CH3)CH2CH2CH(CH3)CH3

5. CH3(CH2)3CºCH

6. CH(Br)2CH2CH2CºCC(CH3)3

7. CH3(CH3)CH=CH2

8. CH3CH2CH2C(CH3)=C(CH3)CH2CH3

9. CH3CH2CH(CH3)CºCH

10. CH3CH=CHCH2CH=CH2

What is the oxidation number of Cr in  Au2(CrO4)3



1)    Explain why cycloheptene though very unstable, can be made but cycloheptyne has never been made.

 


how will you improve potential energy value of hydrogen molecule