Question #58182

Assume that 3.0 g of aniline and 4.5 mL of acetic anhydride (density ρ = 1.08 g mL-1) are used in the preparation of acetanilide.
1) What is the limiting reagent? Justify your answer.

2) What is the theoretical yield in grams of acetanilide?

3) What is the % yield if 3.30 g of acetanilide are obtained?

Expert's answer

Answer on Question #58182 – Chemistry – Organic Chemistry

Task:

Assume that 3.0g3.0\,\mathrm{g} of aniline and 4.5mL4.5\,\mathrm{mL} of acetic anhydride (density ρ=1.08gmL1\rho = 1.08\,\mathrm{g}\,\mathrm{mL}^{-1}) are used in the preparation of acetanilide.

1) What is the limiting reagent? Justify your answer.

2) What is the theoretical yield in grams of acetanilide?

3) What is the % yield if 3.30g3.30\,\mathrm{g} of acetanilide are obtained?

Solution:

We write the reaction of interaction the aniline with acetic anhydride to form acetanilide:



We find the molar mass of aniline and acetic anhydride:


M(aniline)=M(C6H5NH2)=12×6+1×7+14×1=93(gmol);M(\text{aniline}) = M(C_6H_5NH_2) = 12 \times 6 + 1 \times 7 + 14 \times 1 = 93\left(\frac{g}{mol}\right);M(acetic anhydride)=M(C4H6O3)=12×4+1×6+16×3=102(gmol).M(\text{acetic anhydride}) = M(C_4H_6O_3) = 12 \times 4 + 1 \times 6 + 16 \times 3 = 102\left(\frac{g}{mol}\right).


Convert each substance to moles:


n(aniline)=m(C6H5NH2)M(C6H5NH2)=3g93g/mol=0.0322mol;n(\text{aniline}) = \frac{m(C_6H_5NH_2)}{M(C_6H_5NH_2)} = \frac{3g}{93\,\mathrm{g/mol}} = 0.0322\,\mathrm{mol};n(C4H6O3)=m(C4H6O3)M(C4H6O3)=ρ(C4H6O3)×V(C4H6O3)M(C4H6O3)=1.08g/ml×4.5ml102g/mol=0.0476moln(C_4H_6O_3) = \frac{m(C_4H_6O_3)}{M(C_4H_6O_3)} = \frac{\rho(C_4H_6O_3) \times V(C_4H_6O_3)}{M(C_4H_6O_3)} = \frac{1.08\,\mathrm{g/ml} \times 4.5\,\mathrm{ml}}{102\,\mathrm{g/mol}} = 0.0476\,\mathrm{mol}


1) To find the limiting reagent, take the moles of each substance and divide it by the coefficient of the balanced equation. The substance that has the smallest answer is the limiting reagent.

Determine the limiting reagent:

For aniline: 0.0322/1=0.03220.0322 / 1 = 0.0322

For acetic anhydride: 0.0467/1=0.04760.0467 / 1 = 0.0476

There is enough acetic anhydride to produce 0.0467 mol acetanilide, but only enough aniline to produce 0.0322 mol acetanilide. This means that the amount of acetanilide actually produced is limited by the aniline, which is therefore the limiting reagent.

Answer:

Limiting reagent is aniline.

2) Aniline and acetanilide stand in a one-to-one molar relationship, so 0.0322 mol of aniline produces 0.0322 mol of acetanilide. The amount of acetic anhydride does not play a role, since it is in excess.

Then,


n(aniline)=n(acetanilide)=0.0322mol.n(\text{aniline}) = n(\text{acetanilide}) = 0.0322 \text{mol}.


We find the molar mass of acetanilide:


M(acetanilide)=M(C8H9NO)=12×8+1×9+14×1+16×1=135(gmol).M(\text{acetanilide}) = M(C_8H_9NO) = 12 \times 8 + 1 \times 9 + 14 \times 1 + 16 \times 1 = 135 \left(\frac{g}{mol}\right).


We find the theoretical yield in grams of acetanilide:


m(acetanilide)=n(C8H9NO)×M(C8H9NO)=0.0322mol×135gmol=4.347g4.35g.m(\text{acetanilide}) = n(C_8H_9NO) \times M(C_8H_9NO) = 0.0322 \text{mol} \times 135 \frac{g}{mol} = 4.347g \approx 4.35g.


Answer:

The theoretical yield of acetanilide is 4.35g.

3) What is the % yield if 3.30 g of acetanilide are obtained?

Theoretical yield: 4.35g.

Actual yield: 3.30g.

Percent yield (%Yield):


%Yield=Actual Yield (mass or moles)Theoretical Yield (mass or moles)×100%.\% \text{Yield} = \frac{\text{Actual Yield (mass or moles)}}{\text{Theoretical Yield (mass or moles)}} \times 100\%.


Then,


Percent Yield=Actual YieldTheoretical Yield×100%=3.30g4.35g×100%=75.86%.\text{Percent Yield} = \frac{\text{Actual Yield}}{\text{Theoretical Yield}} \times 100\% = \frac{3.30g}{4.35g} \times 100\% = 75.86\%.


Answer:

Percent yield of acetanilide is 75.86%.

http://www.AssignmentExpert.com/


Need a fast expert's response?

Submit order

and get a quick answer at the best price

for any assignment or question with DETAILED EXPLANATIONS!

LATEST TUTORIALS
APPROVED BY CLIENTS