Question #27591

10.0 ml of a 0.30 M sodium phosphate solution reacts with 20.0 ml of a 0.20 M lead (II) nitrate solution (assume no volume change).
What is the concentration of nitrate and phosphate ions left in solution after the reaction is complete ?

Expert's answer

10.0 ml of a 0.30 M sodium phosphate solution reacts with 20.0 ml of a 0.20 M lead (II) nitrate solution (assume no volume change). What is the concentration of nitrate and phosphate ions left in solution after the reaction is complete?

Solution: Let us write the molecular and ion chemical reaction equations between sodium phosphate and lead (II) nitrate:


2Na3PO4+3Pb(NO3)26NaNO3+Pb3(PO4)26Na++2PO43+3Pb2++6NO36Na++6NO3+Pb3(PO4)22PO43+3Pb2+Pb3(PO4)2\begin{array}{l} 2 \mathrm{Na_3PO_4} + 3 \mathrm{Pb(NO_3)_2} \rightarrow 6 \mathrm{NaNO_3} + \mathrm{Pb_3(PO_4)_2} \downarrow \\ 6 \mathrm{Na^+} + 2 \mathrm{PO_4^{3-}} + 3 \mathrm{Pb^{2+}} + 6 \mathrm{NO_3^-} \rightarrow 6 \mathrm{Na^+} + 6 \mathrm{NO_3^-} + \mathrm{Pb_3(PO_4)_2} \downarrow \\ 2 \mathrm{PO_4^{3-}} + 3 \mathrm{Pb^{2+}} \rightarrow \mathrm{Pb_3(PO_4)_2} \downarrow \\ \end{array}


As it is known, lead (II) phosphate is completely insoluble in the water, so it precipitates.

From the equation you can see, that nitrate ions are staying in the solution without changing their amount, while phosphate ions are becoming a part of insoluble lead (II) phosphate, and transferring from solution into solid phase.

First, we must find, which reagent is in deficiency. To do this, we must compare initial substance amounts of sodium phosphate and lead (II) nitrate:


n(Na3PO4)=V(Na3PO4)C(Na3PO4)/1000=100.3/1000=0.003 mole;n(Pb(NO3)2)=V(Pb(NO3)2)C(Pb(NO3)2)/1000=200.2/1000=0.004 mole;\begin{array}{l} n(\mathrm{Na_3PO_4}) = V(\mathrm{Na_3PO_4}) \cdot C(\mathrm{Na_3PO_4}) / 1000 = 10 \cdot 0.3 / 1000 = 0.003 \text{ mole}; \\ n(\mathrm{Pb(NO_3)_2}) = V(\mathrm{Pb(NO_3)_2}) \cdot C(\mathrm{Pb(NO_3)_2}) / 1000 = 20 \cdot 0.2 / 1000 = 0.004 \text{ mole}; \\ \end{array}


According to the equation, 2 moles of sodium phosphate completely react with 3 moles of lead (II) nitrate. Then, n(Na3PO4)/2=0.0015n(\mathrm{Na_3PO_4}) / 2 = 0.0015 mole; n(Pb(NO3)2)/3=0.00133n(\mathrm{Pb(NO_3)_2}) / 3 = 0.00133 mole;

Comparing these two amounts, we can see that lead (II) nitrate is in deficiency, which means, it will fully react and become a lead (II) phosphate.

Concentration of nitrate ions after the reaction will be:


C(NO3)=2n(Pb(NO3)2)1000V(Pb(NO3)2)+V(Na3PO4)=20.004100010+20=0.267M;C'(NO_3^-) = \frac{2 \cdot n(Pb(NO_3)_2) \cdot 1000}{V(Pb(NO_3)_2) + V(Na_3PO_4)} = \frac{2 \cdot 0.004 \cdot 1000}{10 + 20} = 0.267 M;


After the reaction there will be left such amount of the sodium phosphate in the solution:


n(Na3PO4)=n(Na3PO4)n(Pb(NO3)2)2/3=0.0030.0042/3=0.000333 mole;n'(Na_3PO_4) = n(Na_3PO_4) - n(Pb(NO_3)_2) \cdot 2 / 3 = 0.003 - 0.004 \cdot 2 / 3 = 0.000333 \text{ mole};


Then, concentration of phosphate ions after the reaction will be:


C(PO43)=n(Na3PO4)1000V(Pb(NO3)2)+V(Na3PO4)=0.000333100010+20=0.0111M;C'(PO_4^{3-}) = \frac{n'(Na_3PO_4) \cdot 1000}{V(Pb(NO_3)_2) + V(Na_3PO_4)} = \frac{0.000333 \cdot 1000}{10 + 20} = 0.0111 M;


Answer: After the reaction is complete in solution will be 0.267 M of nitrate ions and 0.0111 M of phosphate ions.

Need a fast expert's response?

Submit order

and get a quick answer at the best price

for any assignment or question with DETAILED EXPLANATIONS!

LATEST TUTORIALS
APPROVED BY CLIENTS