Answer to Question #136935 in Organic Chemistry for Dyllan

Organic Chemistry

Question #136935

Draw the structure of N,N-dimethyl-4-bromohexanamide

Expert's answer

Structure of N,N-dimethyl-4-bromohexanamide is CH3-CH2-CH(Br)-CH2-CH2-CO(NCH3)2

Learn more about our help with Assignments: Organic Chemistry

Comments

No comments. Be the first!

Leave a comment

Related Questions

1. propose a mechanism for the acid catalyzed hydration of 2-methyl-2-butene and name the major product
2. Outline the mechanism of the reaction when the alkyl halide reacts with dilute sodium hydroxide. Nam
3. Propose a detailed mechanism for the reaction of 2-bromo-3-methylbutane with ethanolin the presence
4. Why Aniline is stronger base than Trinitro Aniline?
5. Why is a voltaic cell created in two separate beakers?
6. If an atom gains electrons, why is it called a reduction?
7. Propose a detailed mechanism for the reaction of 2-bromo-3-methylbutane with ethanol in the presence