Answer on Question #66701, Chemistry / Inorganic Chemistry
What happens when each inorganic pigments is placed in each of the following solutions? Details below.
4 Inorganic Pigments: barium white, zinc yellow, chromium oxide green, prussian blue
3 Solutions at room temp: 3M NaOH, 3M HCl, 10% H2SO4
Please explain what happens to each pigment in each solution. Maybe even include a chemical equation?
Answer
1. BaSO4 - barium white:
BaSO4+2NaOH=Ba(OH)2+Na2SO4; dissolution of sediment;
BaSO4+2HCl=BaCl2+H2SO4; dissolution of sediment;
BaSO4 and H2SO4 do not react
2. ZnCrO4 - zinc yellow:
ZnCrO4+2NaOH=Zn(OH)2+Na2CrO4; we received a yellow white;
ZnCrO4+2HCl=ZnCl2+H2CrO4; bleaching;
ZnCrO4+H2SO4=ZnSO4+H2CrO4; bleaching;
3. Cr2O3 - chromium oxide green:
Cr2O3+2NaOH=2NaCrO2+H2O; bleaching;
Cr2O3+6HCl=2CrCl3+3H2O; green became purple;
Cr2O3+3H2SO4=Cr2(SO2)3+3H2O; green became pink;
4. CoO∗4Al2O3 - prussian blue:
CoO and NaOH do not react; Al2O3+2NaOH=2NaAlO2+H2O; without changes;
CoO+2HCl=CoCl2+H2O; Al2O3+6HCl=2AlCl3+3H2O; blue became purple red or pink;
CoO+H2SO4=CoSO4+H2O; Al2O3+H2SO4=Al2(SO4)3+H2O; blue became pink.
Answer provided by https://www.AssignmentExpert.com