Question #65206

In a volume of 0.400 dm^3 of CH2CL2 there are 3.73*10^24 molecules at 25 degree celsius. Calculate
(A) The density of the substance at 25 degree celsius, expressed in g.cm^3.
(B) The number of atoms present in 425g of CH2CL2. (Solve by means of complete numerical development without omitting the statements or the units)

Expert's answer

Answer on Question #65158 - Chemistry - Organic Chemistry

Task:

In a volume of 0.400 dm³ of CH₂Cl₂ there are 3.73*10²⁴ molecules at 25 degree celsius.

Calculate:

(A) The density of the substance at 25 degree celsius, expressed in g.cm³.

(B) The number of atoms present in 425g of CH₂Cl₂. (Solve by means of complete numerical development without omitting the statements or the units)

Solution:

Part (A):

We find the amount of CH₂Cl₂, using the following formula:


n=NNa;n = \frac {N}{N _ {a}};n \left(\mathrm{CH_2Cl_2}\right) = \frac {N \left(\mathrm{CH_2Cl_2}\right)}{N _ {a}} = \frac {3.73 \times 10^{24}}{6.022 \times 10^{23}} = 6.194 \text{ (moles of } \mathrm{CH_2Cl_2\text{)}


We find the mass of CH₂Cl₂, using the following formula:


n=mM;m=n×Mn = \frac {m}{M}; \quad \Rightarrow \quad m = n \times MM(CH2Cl2)=84.93gmolM \left(\mathrm{CH_2Cl_2}\right) = 84.93 \frac{g}{mol}m(CH2Cl2)=n(CH2Cl2)×M(CH2Cl2);m \left(\mathrm{CH_2Cl_2}\right) = n \left(\mathrm{CH_2Cl_2}\right) \times M \left(\mathrm{CH_2Cl_2}\right);m(CH2Cl2)=6.194 mol×84.93gmol=526.056 gm \left(\mathrm{CH_2Cl_2}\right) = 6.194 \text{ mol} \times 84.93 \frac{g}{mol} = 526.056 \text{ g}


Convert dm³ in L:


1 dm3=1 L=1000 mL=1000 cm3;1 \text{ dm}^3 = 1 \text{ L} = 1000 \text{ mL} = 1000 \text{ cm}^3;0.400 dm3=X mL;0.400 \text{ dm}^3 = X \text{ mL};X=V(CH2Cl2)=1000 cm3×0.400 dm31 dm3=400 cm3X = V \left(\mathrm{CH_2Cl_2}\right) = \frac {1000 \text{ cm}^3 \times 0.400 \text{ dm}^3}{1 \text{ dm}^3} = 400 \text{ cm}^3


We find the density of the substance, using the following formula:


ρ=mV;\rho = \frac {m}{V};ρ(CH2Cl2)=m(CH2Cl2)V(CH2Cl2)=526.056 g400 cm3=1.31514gcm3\rho \left(\mathrm{CH_2Cl_2}\right) = \frac {m \left(\mathrm{CH_2Cl_2}\right)}{V \left(\mathrm{CH_2Cl_2}\right)} = \frac {526.056 \text{ g}}{400 \text{ cm}^3} = 1.31514 \frac{g}{\text{cm}^3}


Answer (A): The density of the substance is 1.31514 gcm31.31514\ \mathrm{g}\cdot \mathrm{cm}^{-3}

Part (B):

We find the amount of CH2Cl2\mathrm{CH}_2\mathrm{Cl}_2, using the following formula:


n=mM;n = \frac{m}{M};n(CH2Cl2)=m(CH2Cl2)M(CH2Cl2)=425 g84.93 g/mol=5.004 (moles of CH2Cl2)n(\mathrm{CH}_2\mathrm{Cl}_2) = \frac{m(\mathrm{CH}_2\mathrm{Cl}_2)}{M(\mathrm{CH}_2\mathrm{Cl}_2)} = \frac{425\ \mathrm{g}}{84.93\ \mathrm{g/mol}} = 5.004\ (\mathrm{moles\ of\ CH_2Cl_2})


We find the number of molecules of CH2Cl2\mathrm{CH}_2\mathrm{Cl}_2, using the following formula:


n=NNa;N=n×Na;n = \frac{N}{N_a}; \quad \Rightarrow \quad N = n \times N_a;N(molecules)=n(CH2Cl2)×Na;N(\text{molecules}) = n(\mathrm{CH}_2\mathrm{Cl}_2) \times N_a;N(molecules of CH2Cl2)=5.004×6.022×1023=30.134×1023N(\text{molecules\ of\ CH}_2\mathrm{Cl}_2) = 5.004 \times 6.022 \times 10^{23} = 30.134 \times 10^{23}


In molecule CH2Cl2\mathrm{CH}_2\mathrm{Cl}_2 contains 5 atoms. Then,


N(atoms)=5×N;N(\text{atoms}) = 5 \times N;N(atoms of CH2Cl2)=5×30.134×1023=1.5067×1025N(\text{atoms\ of\ CH}_2\mathrm{Cl}_2) = 5 \times 30.134 \times 10^{23} = 1.5067 \times 10^{25}


Answer (B): The number of atoms =1.50671025= 1.5067 \cdot 10^{25}.

Answer provided by AssignmentExpert.com


Need a fast expert's response?

Submit order

and get a quick answer at the best price

for any assignment or question with DETAILED EXPLANATIONS!

LATEST TUTORIALS
APPROVED BY CLIENTS