Question #61228

2. Strontium Hydride solid reacts with water to form strontium hydroxide and hydrogen gas:
SrH2(s) + H2O(L)®Sr(OH)2(s) + H2(g)
How many grams of H2Oand SrH2are required to produce 500 grams of Sr(OH)2?Also, find the volume of hydrogen gas that will be produced from the reaction? Assume the condition is at STP.

Expert's answer

Answer on the question #61228, Chemistry / Inorganic Chemistry

Question:

Strontium Hydride solid reacts with water to form strontium hydroxide and hydrogen gas: SrH2(s)+H2O(L)Sr(OH)2(s)+H2(g)\mathrm{SrH_2(s) + H_2O(L)^*Sr(OH)_2(s) + H_2(g)}

How many grams of H2O and SrH2 are required to produce 500 grams of Sr(OH)2\mathrm{Sr(OH)_2}? Also, find the volume of hydrogen gas that will be produced from the reaction? Assume the condition is at STP.

Solution:

The reaction equation is:


SrH2(s)+2H2O(L)Sr(OH)2(s)+2H2(g)S r H _ {2 (s)} + 2 H _ {2} O _ {(L)} \rightarrow S r (O H) _ {2 (s)} + 2 H _ {2 (g)}


The number of the moles ratio for the reaction reagents and products is:


n(SrH2(s))=n(H2O)2=n(Sr(OH)2(s))=n(H2(g))2n \left(S r H _ {2 (s)}\right) = \frac {n \left(H _ {2} O\right)}{2} = n \left(S r \left(O H\right) _ {2 (s)}\right) = \frac {n \left(H _ {2 (g)}\right)}{2}


From the mass, 500g500\mathrm{g} of Sr(OH)2(s)Sr(OH)_{2(s)}, we can calculate the number of the moles of Sr(OH)2(s)Sr(OH)_{2(s)} and of each substance that took part in the reaction:


n(Sr(OH)2(s))=m(Sr(OH)2(s))M(Sr(OH)2(s))=500(g)121.6347(gmol)=4.11mol.n \left(S r \left(O H\right) _ {2 (s)}\right) = \frac {m \left(S r \left(O H\right) _ {2 (s)}\right)}{M \left(S r \left(O H\right) _ {2 (s)}\right)} = \frac {5 0 0 (g)}{1 2 1 . 6 3 4 7 \left(\frac {g}{m o l}\right)} = 4. 1 1 m o l.


Then, the number of the moles of SrH2(s)SrH_{2(s)}, used in the reaction, is also equal to 4.11 mol. The number of the moles of H2OH_{2}O used and of H2(g)H_{2(g)} produced are: 4.112=8.224.11 \cdot 2 = 8.22 mol.

The mass of SrH2(s)SrH_{2(s)} and of H2OH_{2}O, required to produce 500g of Sr(OH)2(s)Sr(OH)_{2(s)}, are:


m(SrH2(s))=n(SrH2(s))M(SrH2(s))=4.11(mol)89.6359(gmol)=369gm(H2O)=n(H2O)M(H2O)=8.22(mol)18.0153(gmol)=148g\begin{array}{l} m \left(S r H _ {2 (s)}\right) = n \left(S r H _ {2 (s)}\right) \cdot M \left(S r H _ {2 (s)}\right) = 4. 1 1 (m o l) \cdot 8 9. 6 3 5 9 \left(\frac {g}{m o l}\right) = 3 6 9 g \\ m \left(H _ {2} O\right) = n \left(H _ {2} O\right) \cdot M \left(H _ {2} O\right) = 8. 2 2 (m o l) \cdot 1 8. 0 1 5 3 \left(\frac {g}{m o l}\right) = 1 4 8 g \\ \end{array}


The volume of 1 mole of gas at STP is 22.4 L. Then, the volume of H2(g)H_{2(g)} produced is:


V(H2(g))=8.22(mol)22.4(Lmol)=184LV \left(H _ {2 (g)}\right) = 8. 2 2 (m o l) \cdot 2 2. 4 \left(\frac {L}{m o l}\right) = 1 8 4 L


Answer: The masses of SrH2(s)SrH_{2(s)} and of H2OH_{2}O, required to produce 500g of Sr(OH)2(s)Sr(OH)_{2(s)}, are 369 g and 148 g, respectively. The volume of hydrogen gas produced, taking STP conditions, is 184 L.

http://www.AssignmentExpert.com


Need a fast expert's response?

Submit order

and get a quick answer at the best price

for any assignment or question with DETAILED EXPLANATIONS!

LATEST TUTORIALS
APPROVED BY CLIENTS