Question #50445

1. If an electric discharge produces 800 cm3 of ozone (O3), how many cm3 of oxygen (O2) are required?

3O2(g) ---> 2O3(g)





2. When 75.0 dm3 of O2 react with an excess of glucose (C6H12O2), according to the reaction below, what volume of carbon dioxide will be produced?

6O2(g) + C6H12O6(s) ---> 6H2O(g) + 6CO2(g)

Expert's answer

Answer on the question #50445, Chemistry, Inorganic Chemistry

Question:

1. If an electric discharge produces 800 cm³ of ozone (O₃), how many cm³ of oxygen (O₂) are required?

3O₂(g) ---> 2O₃(g)

2. When 75.0 dm³ of O₂ react with an excess of glucose (C₆H₁₂O₂), according to the reaction below, what volume of carbon dioxide will be produced?

6O₂(g) + C₆H₁₂O₆(s) ---> 6H₂O(g) + 6CO₂(g)

Solution:

1) According to the chemical reaction equation 3O₂(g) ---> 2O₃(g):


n(O2)3=n(O3)2n(O2)=3n(O3)2\frac{n(O_2)}{3} = \frac{n(O_3)}{2} \Rightarrow n(O_2) = \frac{3n(O_3)}{2}


From molar volume definition:


V(O2)=Vmn(O2)V(O_2) = V_m \cdot n(O_2)V(O3)=Vmn(O3)n(O3)=V(O3)VmV(O_3) = V_m \cdot n(O_3) \Rightarrow n(O_3) = \frac{V(O_3)}{V_m}V(O2)=Vm3n(O3)2=Vm3V(O3)2Vm=3V(O3)2=38002=1200 cm3V(O_2) = V_m \cdot \frac{3n(O_3)}{2} = V_m \cdot \frac{3V(O_3)}{2V_m} = \frac{3V(O_3)}{2} = \frac{3 \cdot 800}{2} = 1200 \text{ cm}^3


2) According to the chemical reaction equation 6O₂(g) + C₆H₁₂O₆(s) ---> 6H₂O(g) + 6CO₂(g):


n(O2)6=n(CO2)6n(O2)=n(CO2)\frac{n(O_2)}{6} = \frac{n(CO_2)}{6} \Rightarrow n(O_2) = n(CO_2)


As the volume is proportional to the number of the moles with the molar volume coefficient,


V(O2)=V(CO2)=75.0 dm3V(O_2) = V(CO_2) = 75.0 \text{ dm}^3


Answer: 1) 1200 cm³, 2) 75.0 dm³

https://www.AssignmentExpert.com

Need a fast expert's response?

Submit order

and get a quick answer at the best price

for any assignment or question with DETAILED EXPLANATIONS!

LATEST TUTORIALS
APPROVED BY CLIENTS