Question #36790

How many grams go propane can be burned by 24g of O2?
1

Expert's answer

2013-11-07T08:06:11-0500

How many grams go propane can be burned by 24g of O2O_2?

Solution:

Propane burning can occur as follows:

Complete oxidation of propane

1. CH2(CH3)2+5O2=3CO2+4H2OCH_{2}(CH_{3})_{2} + 5O_{2} = 3CO_{2} + 4H_{2}O

Partial oxidation of propane

2. 2CH2(CH3)2+7O2=3CO+8H2O2CH_{2}(CH_{3})_{2} + 7O_{2} = 3CO + 8H_{2}O

3. CH2(CH3)2+2O2=3C+4H2OCH_{2}(CH_{3})_{2} + 2O_{2} = 3C + 4H_{2}O

Find number of moles of oxygen


n(O2)=m(O2)/M(O2)n(O_2) = m(O_2) / M(O_2)n(O2)=24g/32gmol1=0.75moln(O_2) = 24g / 32g \cdot mol^{-1} = 0.75mol


Find number of moles of propane (n1,n2,n3)(n_1, n_2, n_3) for each reaction equation


n1(CH2(CH3)2)=n(O2)/5n1(CH2(CH3)2)=0.75mol/5=0.15mol\begin{array}{l} n_1(CH_2(CH_3)_2) = n(O_2) / 5 \\ n_1(CH_2(CH_3)_2) = 0.75mol / 5 = 0.15mol \\ \end{array}n2(CH2(CH3)2)=n(O2)/3.5n2(CH2(CH3)2)=0.75mol/3.5=0.214mol\begin{array}{l} n_2(CH_2(CH_3)_2) = n(O_2) / 3.5 \\ n_2(CH_2(CH_3)_2) = 0.75mol / 3.5 = 0.214mol \\ \end{array}n3(CH2(CH3)2)=n(O2)/2n3(CH2(CH3)2)=0.75mol/2=0.375mol\begin{array}{l} n_3(CH_2(CH_3)_2) = n(O_2) / 2 \\ n_3(CH_2(CH_3)_2) = 0.75mol / 2 = 0.375mol \\ \end{array}


Find weight of propane for each reaction equation


m1(CH2(CH3)2)=n1(CH2(CH3)2)M(CH2(CH3)2)m1(CH2(CH3)2)=0.15mol44gmol1=6.6g\begin{array}{l} m_1(CH_2(CH_3)_2) = n_1(CH_2(CH_3)_2) * M(CH_2(CH_3)_2) \\ m_1(CH_2(CH_3)_2) = 0.15mol * 44g \cdot mol^{-1} = 6.6g \\ \end{array}m2(CH2(CH3)2)=n2(CH2(CH3)2)M(CH2(CH3)2)m2(CH2(CH3)2)=0.214mol44gmol1=9.416g\begin{array}{l} m_2(CH_2(CH_3)_2) = n_2(CH_2(CH_3)_2) * M(CH_2(CH_3)_2) \\ m_2(CH_2(CH_3)_2) = 0.214mol * 44g \cdot mol^{-1} = 9.416g \\ \end{array}m3(CH2(CH3)2)=n3(CH2(CH3)2)M(CH2(CH3)2)m3(CH2(CH3)2)=0.375mol44gmol1=16.5g\begin{array}{l} m_3(CH_2(CH_3)_2) = n_3(CH_2(CH_3)_2) * M(CH_2(CH_3)_2) \\ m_3(CH_2(CH_3)_2) = 0.375mol * 44g \cdot mol^{-1} = 16.5g \\ \end{array}


Answer: In 24 g of oxygen during the partial oxidation 16.5 g of propane can be burnt.

Need a fast expert's response?

Submit order

and get a quick answer at the best price

for any assignment or question with DETAILED EXPLANATIONS!

Comments

No comments. Be the first!
LATEST TUTORIALS
APPROVED BY CLIENTS