Question #36760

A certain amount of hydrogen peroxide was dissolved in 100 mL of water and then titrated with 1.68 M KMnO[sub]4[/sub]. How much H[sub]2[/sub]O[sub]2[/sub] was dissolved if the titration required 18.3 mL of the KMnO[sub]4[/sub] solution?


2KMnO[sub]4[/sub](aq) + H[sub]2[/sub]O[sub]2[/sub](aq) + 3H[sub]2[/sub]SO[sub]4[/sub](aq) → 3O[sub]2[/sub](g) + 2MnSO[sub]4[/sub](aq) + K[sub]2[/sub]SO[sub]4[/sub](aq) + 4H[sub]2[/sub]O(l)

Expert's answer

Answer on Question #36760 - Chemistry - Inorganic Chemistry

Question:

A certain amount of hydrogen peroxide was dissolved in 100 mL100~\mathrm{mL} of water and then titrated with 1.68M1.68\mathrm{M} KMnO4\mathrm{KMnO_4} . How much H2O2\mathrm{H}_2\mathrm{O}_2 was dissolved if the titration required 18.3 mL18.3~\mathrm{mL} of the KMnO4\mathrm{KMnO_4} solution?


2KMnO4(aq)+H2O2(aq)+3H2SO4(aq)3O2(g)+2MnSO4(aq)+K2SO4(aq)+4H2O(l)2 \mathrm {K M n O} _ {4} (\mathrm {a q}) + \mathrm {H} _ {2} \mathrm {O} _ {2} (\mathrm {a q}) + 3 \mathrm {H} _ {2} \mathrm {S O} _ {4} (\mathrm {a q}) \rightarrow 3 \mathrm {O} _ {2} (\mathrm {g}) + 2 \mathrm {M n S O} _ {4} (\mathrm {a q}) + \mathrm {K} _ {2} \mathrm {S O} _ {4} (\mathrm {a q}) + 4 \mathrm {H} _ {2} \mathrm {O} (\mathrm {l})V(H2O)=100ml;V \left(H _ {2} O\right) = 1 0 0 m l;C(KMnO4)=1.68M;C (K M n O _ {4}) = 1. 6 8 M;V(KMnO4)=18.3ml.V (K M n O _ {4}) = 1 8. 3 m l.m(H2O2)?\mathrm {m} \left(\mathrm {H} _ {2} \mathrm {O} _ {2}\right) -?

Solution:

In the direct titration the equivalent number of moles of the substance (hydrogen peroxide) equals to the equivalent number of moles of the titrant (potassium permanganate). In permanganometric titration such a reaction takes place


5H2O2+2MnO4+6H+5O2+8H2O+2Mn2+5 \mathrm {H} _ {2} \mathrm {O} _ {2} + 2 \mathrm {M n O} _ {4} ^ {-} + 6 \mathrm {H} ^ {+} \rightarrow 5 \mathrm {O} _ {2} + 8 \mathrm {H} _ {2} \mathrm {O} + 2 \mathrm {M n} ^ {2 +}


The half-reactions corresponding to this reaction are:


MnO4+8H++5eMn2++4H2\mathrm {M n O} _ {4} ^ {-} + 8 \mathrm {H} ^ {+} + 5 \mathrm {e} \rightarrow \mathrm {M n} ^ {2 +} + 4 \mathrm {H} _ {2}H2O22eO2+2H+\mathrm {H} _ {2} \mathrm {O} _ {2} - 2 \mathrm {e} \rightarrow \mathrm {O} _ {2} + 2 \mathrm {H} ^ {+}

fx(KMnO4)=1/5f_{x}(\mathrm{KMnO}_{4}) = 1 / 5 , and fx(H2O2)=1/2f_{x}(\mathrm{H}_{2}\mathrm{O}_{2}) = 1 / 2 , since one electron is chemically equivalent to conventional particles 1/5KMnO41 / 5\mathrm{KMnO}_{4} and 12H2O2\frac{1}{2}\mathrm{H}_{2}\mathrm{O}_{2} .

Consequently: n(1/5KMnO4)=5c(KMnO4)V(KMnO4)n\left( {1/{5KMnO}_{4}}\right) = 5 \cdot c\left( {{KMnO}_{4}}\right) \cdot V\left( {{KMnO}_{4}}\right)

n(1/2H2O2)=m(H2O2)/M(1/2H2O2)n \left(^ {1} / _ {2} H _ {2} O _ {2}\right) = m \left(H _ {2} O _ {2}\right) / M \left(^ {1} / _ {2} H _ {2} O _ {2}\right)


As far as n(1/5KMnO4)=n(1/2H2O2)n\left( {1/{5KMnO}_{4}}\right) = n\left( {1/{2H}_{2}{O}_{2}}\right) ,after the transformation we can find out that:


m(H2O2)=5c(KMnO4)V(KMnO4)M(1/2H2O2)=51.680.018318.015=2.614gm \left(\mathrm {H} _ {2} \mathrm {O} _ {2}\right) = 5 \cdot c \left(\mathrm {K M n O} _ {4}\right) \cdot V \left(\mathrm {K M n O} _ {4}\right) \cdot \mathrm {M} \left(^ {1} / _ {2} \mathrm {H} _ {2} \mathrm {O} _ {2}\right) = 5 \cdot 1. 6 8 \cdot 0. 0 1 8 3 \cdot 1 8. 0 1 5 = 2. 6 1 4 \mathrm {g}


Answer: m=2.77m = 2.77 g

Need a fast expert's response?

Submit order

and get a quick answer at the best price

for any assignment or question with DETAILED EXPLANATIONS!

LATEST TUTORIALS
APPROVED BY CLIENTS