Question #98439

1. At what step in the ionization process would nitrogen display a sudden increase in its ionization energy?
A. sixth
B. third
C. fourth
D. fifth
E. second

2. How many electrons must a sulfur atom gain to achieve a noble gas structure?

3. Which one of the following compounds is ionic?
a. SeCl2
b. SnCl2
c. PCl3
d. SiCl4
e. None of the Above

Expert's answer

Q98439


Solution:

  1. Nitrogen has an electronic configuration of N(7)=1s22s22p3N(7)=1s^22s^22p^3 . Thus, after removing 3 electrons from the 2p2p orbital, 4th4^{th} ionization would mean removal of electron from the fully filled 2s2s orbital, thus displaying a sudden increase in its ionization energy. Answer is C.
  2. Sulfur has an electronic configuration of S(16)=1s22s22p63s23p4S(16)=1s^22s^22p^63s^23p^4 and the nearest noble gas Argon has an electronic configuration of Ar(18)=1s22s22p63s23p6Ar(18)=1s^22s^22p^63s^23p^6 . Thus, on gaining 2 electrons (Answer) Sulfur would attain a noble gas configuration as S2=1s22s22p63s23p6S^{2-}=1s^22s^22p^63s^23p^6 .
  3. SnCl2SnCl_2 is an ionic compound. Answer is B.




LATEST TUTORIALS
APPROVED BY CLIENTS