Question #96611

1. What volume of a 0.200 M calcium hydroxide solution is required to neutralize 19.8 mL of a 0.144 M perchloric acid solution?

__mL calcium hydroxide

2. What volume of a 0.102 M nitric acid solution is required to neutralize 13.0 mL of a 0.143 M sodium hydroxide solution?

___mL nitric acid

Expert's answer

Question 1.

The chemical reaction between calcium hydroxide and perchloric acid can be written as


Ca(OH)2+2HClO4Ca(ClO4)2+2H2OCa{(OH)_2} + 2HCl{O_4} \to Ca{(Cl{O_4})_2} + 2{H_2}O

Thus we see, that they react 1 to 2 (1 mole of calcium hydroxide to 2 moles of perchloric acid). The number of moles of calcium hydroxide we need to neutralize can be calculated as νHClO4=CHClO4VHClO4{\nu _{HCl{O_4}}} = {C_{HCl{O_4}}} \cdot {V_{HCl{O_4}}} , the number of moles of calcium hydroxide is the half of νHClO4{\nu _{HCl{O_4}}} , thus we can write


CCa(OH)2VCa(OH)2=νCa(OH)2=νHClO42=12CHClO4VHClO4{C_{Ca{{(OH)}_2}}} \cdot {V_{Ca{{(OH)}_2}}} = {\nu _{Ca{{(OH)}_2}}} = {{{\nu _{HCl{O_4}}}} \over 2} = {1 \over 2}{C_{HCl{O_4}}} \cdot {V_{HCl{O_4}}}

Then


VCa(OH)2=12CHClO4CCa(OH)2VHClO4{V_{Ca{{(OH)}_2}}} = {1 \over 2}{{{C_{HCl{O_4}}}} \over {{C_{Ca{{(OH)}_2}}}}} \cdot {V_{HCl{O_4}}}

Let's do the calculations


VCa(OH)2=120.144[M]0.200[M]19.8[mL]=7.128[mL]{V_{Ca{{(OH)}_2}}} = {1 \over 2}{{0.144[{\rm{M}}]} \over {0.200[{\rm{M}}]}} \cdot 19.8[{\rm{mL}}] = 7.128[{\rm{mL}}]

Answer: VCa(OH)2=7.128[mL]{V_{Ca{{(OH)}_2}}} = 7.128[{\rm{mL}}]


Question 2.

The chemical reaction between nitric acid and sodium hydroxide can be written as


NaOH+HNO3=NaNO3+H2ONaOH + HN{O_3} = NaN{O_3} + {H_2}O

All reasoning are the same as in Question 1 except now they react 1 to 1, thus


VHNO3=CNaOHCHNO3VNaOH{V_{HN{O_3}}} = {{{C_{NaOH}}} \over {{C_{HN{O_3}}}}} \cdot {V_{NaOH}}VHNO3=0.143[M]0.102[M]13.0[mL]18.2255[mL]{V_{HN{O_3}}} = {{0.143[{\rm{M}}]} \over {0.102[{\rm{M}}]}} \cdot 13.0[{\rm{mL}}] \approx 18.2255[{\rm{mL}}]


LATEST TUTORIALS
APPROVED BY CLIENTS