1.05 atm is 106391.25 Pa
35 deg. C is 308 K
Number of moles of H2 gas involved in the reaction:
n(H2)=2molg18.6g=9.3mol
According to the reaction equation quantity in moles of produced acetic acid is two times less than H2. Thus,
n(CH3COOH)=29.3mol=4.65mol
Using general gas equation pV=nRT (where R is ideal gas constant) we are able to find the volume of acetic acid gas:
V=106391.25Pa4.65mol⋅8.314K⋅molm3⋅Pa⋅308K=0.112m3=112L