Question #83900

10.4 grams of chromium(Cr) reacted with fluorine gas (F2) to produce 25.6 grams of chromium Florine salt reaction : __Cr(s) +__ F2 (g) —> __Cr? F? (S)

1) how many grams reacted?
2) how many miles of flurorine atoms reacted?
3) how many miles of chromium atoms reacted?
4) what is the chemical formula produced?
6) what is the anion
7) what is the cation of this salt?
8) which element went through reduction?
1

Expert's answer

2018-12-27T05:19:00-0500

10.4 grams of chromium (Cr) reacted with fluorine gas (F₂) to produce 25.6 grams of chromium

Florine salt reaction: _Cr(s) + _F₂(g) → _Cr? F? (s)

1) how many grams reacted?

2) how many miles of fluorine atoms reacted?

3) how many miles of chromium atoms reacted?

4) what is the chemical formula produced?

6) what is the anion

7) what is the cation of this salt?

8) which element went through reduction?

Solution.


Cr(s)+2F2(g)CrF4n(Cr)=m(Cr)M(Cr)=10.452=0.2 moln(Cr)=m(CrF4)M(CrF)=25.6128=0.2 moln(F2)=n(Cr)×2=0.2×2=0.4 molm(F2)=n(F2)×M(F2)=0.4×38=15.2 g\begin{array}{l} \mathrm{Cr}(s) + 2\mathrm{F}_2(g) \rightarrow \mathrm{CrF}_4 \\ n(\mathrm{Cr}) = \frac{m(\mathrm{Cr})}{M(\mathrm{Cr})} = \frac{10.4}{52} = 0.2 \text{ mol} \\ n(\mathrm{Cr}) = \frac{m(\mathrm{CrF}_4)}{M(\mathrm{CrF})} = \frac{25.6}{128} = 0.2 \text{ mol} \\ n(\mathrm{F}_2) = n(\mathrm{Cr}) \times 2 = 0.2 \times 2 = 0.4 \text{ mol} \\ m(\mathrm{F}_2) = n(\mathrm{F}_2) \times M(\mathrm{F}_2) = 0.4 \times 38 = 15.2 \text{ g} \\ \end{array}


The anion is F⁻.

The cation is Cr⁴⁺.

The element F went through reduction.

Answer provided by www.AssignmentExpert.com


Need a fast expert's response?

Submit order

and get a quick answer at the best price

for any assignment or question with DETAILED EXPLANATIONS!

Comments

No comments. Be the first!
LATEST TUTORIALS
APPROVED BY CLIENTS