Answer on Question#57210 – Chemistry – General chemistry
Question: Combustion of 2.78 g of ethyl butyrate leads to the formation of 6.32 g of CO₂ and 2.58 g of H₂O. The Molar mass is between 100 and 150. What is the empirical and molecular formula?
Solution:
1. Ethyl butyrate is compound that contains C, H and perhaps O. Check the presence of O:
m(O2)=m(CO2)+m(H2O)−m(ethyl butyrate)=6.32g+2.58g−2.78g=6.12g.
In CO2:
w(O)=M(CO2)M(O)=44g/mol2⋅16g/mol=0.7272m1(O)=w(O)⋅m(CO2)=0.7272⋅6.32g=4.5959g
In H2O:
w(O)=M(H2O)M(O)=18g/mol16g/mol=0.8889m2(O)=w(O)⋅m(H2O)=0.8889⋅2.58=2.2934gm1(O)+m2(O)=4.5959g+2.2934g=6.89gm1(O)+m2(O)>m(O2)−so our compound contains O
2. Find the empirical formula:
n(CO2)=44g/mol6.32g=0.1436moln(H2O)=18g/mol2.58g=0.1433moln(O2)=32g/mol6.12g=0.19125mol
In ethyl butyrate:
n(C)=n(CO2)=0.1436moln(H)=n(H2O)=0.2866moln(O)=n(H2O)+2n(CO2)−2n(O2)=0.1433mol+0.2872mol−0.3825mol=0.048molN(C):N(H):N(O)=0.1436:0.2866:0.048=3:6:1
So C3H6O is empirical formula of ethyl butyrate.
3. Find the molecular formula. Molecular formula of ethyl butyrate is (C3H6O)n
M(C3H6O)=58g/molnmin=58100=1.72nmax=58150=2.59
The only integer is 2. So molecular formula is C6H12O2.
**Answer:** empirical formula is C3H6O
molecular formula is C6H12O2.
www.AssignmentExpert.com