Question #57210

Combustion of 2.78 g of ethyl butyrate leads to the formation of 6.32 g of CO2 and 2.58 g of H2O. The Molar mass is between 100 and 150. What is the empirical and molecular formula?
1

Expert's answer

2016-01-07T08:21:59-0500

Answer on Question#57210 – Chemistry – General chemistry

Question: Combustion of 2.78 g of ethyl butyrate leads to the formation of 6.32 g of CO₂ and 2.58 g of H₂O. The Molar mass is between 100 and 150. What is the empirical and molecular formula?

Solution:

1. Ethyl butyrate is compound that contains C, H and perhaps O. Check the presence of O:


m(O2)=m(CO2)+m(H2O)m(ethyl butyrate)=6.32g+2.58g2.78g=6.12g.m(O_2) = m(CO_2) + m(H_2O) - m(\text{ethyl butyrate}) = 6.32\,g + 2.58\,g - 2.78\,g = 6.12\,g.


In CO2CO_2:


w(O)=M(O)M(CO2)=216g/mol44g/mol=0.7272w(O) = \frac{M(O)}{M(CO_2)} = \frac{2 \cdot 16\,g/mol}{44\,g/mol} = 0.7272m1(O)=w(O)m(CO2)=0.72726.32g=4.5959gm_1(O) = w(O) \cdot m(CO_2) = 0.7272 \cdot 6.32\,g = 4.5959\,g


In H2OH_2O:


w(O)=M(O)M(H2O)=16g/mol18g/mol=0.8889w(O) = \frac{M(O)}{M(H_2O)} = \frac{16\,g/mol}{18\,g/mol} = 0.8889m2(O)=w(O)m(H2O)=0.88892.58=2.2934gm_2(O) = w(O) \cdot m(H_2O) = 0.8889 \cdot 2.58 = 2.2934\,gm1(O)+m2(O)=4.5959g+2.2934g=6.89gm_1(O) + m_2(O) = 4.5959\,g + 2.2934\,g = 6.89\,gm1(O)+m2(O)>m(O2)so our compound contains Om_1(O) + m_2(O) > m(O_2) - \text{so our compound contains O}


2. Find the empirical formula:


n(CO2)=6.32g44g/mol=0.1436moln(CO_2) = \frac{6.32\,g}{44\,g/mol} = 0.1436\,moln(H2O)=2.58g18g/mol=0.1433moln(H_2O) = \frac{2.58\,g}{18\,g/mol} = 0.1433\,moln(O2)=6.12g32g/mol=0.19125moln(O_2) = \frac{6.12\,g}{32\,g/mol} = 0.19125\,mol


In ethyl butyrate:


n(C)=n(CO2)=0.1436moln(C) = n(CO_2) = 0.1436\,moln(H)=n(H2O)=0.2866moln(H) = n(H_2O) = 0.2866\,moln(O)=n(H2O)+2n(CO2)2n(O2)=0.1433mol+0.2872mol0.3825mol=0.048moln(O) = n(H_2O) + 2n(CO_2) - 2n(O_2) = 0.1433\,mol + 0.2872\,mol - 0.3825\,mol = 0.048\,molN(C):N(H):N(O)=0.1436:0.2866:0.048=3:6:1N(C) : N(H) : N(O) = 0.1436 : 0.2866 : 0.048 = 3 : 6 : 1


So C3H6OC_3H_6O is empirical formula of ethyl butyrate.

3. Find the molecular formula. Molecular formula of ethyl butyrate is (C3H6O)n(C_3H_6O)_n

M(C3H6O)=58g/molM(C_3H_6O) = 58\,g/molnmin=10058=1.72n_{\min} = \frac{100}{58} = 1.72nmax=15058=2.59n_{\max} = \frac{150}{58} = 2.59


The only integer is 2. So molecular formula is C6H12O2C_6H_{12}O_2.

**Answer:** empirical formula is C3H6OC_3H_6O

molecular formula is C6H12O2C_6H_{12}O_2.

www.AssignmentExpert.com


Need a fast expert's response?

Submit order

and get a quick answer at the best price

for any assignment or question with DETAILED EXPLANATIONS!

Comments

No comments. Be the first!
LATEST TUTORIALS
APPROVED BY CLIENTS