Question #55401

1. How many moles of BaCl2 are formed in the neutralization of 196.5 mL of 0.095 M Ba(OH)2 with aqueous HCl?
2. Lead ions an be precipitated from aqueous solutions by the addition of aqueous iodide: Pb+2(aq) + 2I-2 (aq) =PbI2(s) . Lead iodideis virtually insoluble in water so that the reaction appears to go to completion. How many milliliters of 1.180 M HI(aq) must be added to a solution containing 0.200 mol of Pb(NO3)2 (aq) to completely precipitate the lead?
3. What is the molarityof a NaOH solution if 15.5 mL of a 0.220 M H2SO4 solution is required to neutralize a 25.0 mL sample of the NaOH solution?
4. Aqueous solutions of a compound did not form precipitates with Cl-, Br-, I-, SO4-2, CO3-2, PO4-3, OH-, or S-2. This highly water soluble compound produced the foul-smelling gas H2S when the solution was acidified. This compound is _______.

Expert's answer

Answer on Question #55401 - Chemistry - General chemistry

Question:

1. How many moles of BaCl₂ are formed in the neutralization of 196.5 mL of 0.095 M Ba(OH)₂ with aqueous HCl?

2. Lead ions can be precipitated from aqueous solutions by the addition of aqueous iodide: Pb+2(aq) + 2I-2 (aq) = PbI2(s). Lead iodide is virtually insoluble in water so that the reaction appears to go to completion. How many milliliters of 1.180 M Hl(aq) must be added to a solution containing 0.200 mol of Pb(NO₃)₂ (aq) to completely precipitate the lead?

3. What is the molarity of a NaOH solution if 15.5 mL of a 0.220 M H₂SO₄ solution is required to neutralize a 25.0 mL sample of the NaOH solution?

4. Aqueous solutions of a compound did not form precipitates with Cl-, Br-, I-, SO₄²⁻, CO₃²⁻, PO₄³⁻, OH⁻, or S-2. This highly water soluble compound produced the foul-smelling gas H₂S when the solution was acidified. This compound is ________.

Solution:

1. Ba(OH)2+2HClBaCl2+2H2OBa(OH)_2 + 2HCl \rightarrow BaCl_2 + 2H_2O

C=nVC = \frac{n}{V}n=V×Cn = V \times Cn=1.965×102×0.095n = 1.965 \times 10^{-2} \times 0.095n=1.87×102n = 1.87 \times 10^{-2}n(Ba(OH)2)=nBaCl2n_{(Ba(OH)2)} = n_{BaCl2}


Answer: 1.87×1021.87 \times 10^{-2} moles

2. Pb(NO3)2+2HIPbI2+2HNO3Pb(NO_3)_2 + 2HI \rightarrow PbI_2 + 2HNO_3

C=nVC = \frac{n}{V}V=nCV = \frac{n}{C}n(HI)=2×n(Pb(NO3)2)=0.4 moln(HI) = 2 \times n(Pb(NO_3)_2) = 0.4 \text{ mol}V=0.41.18V = \frac{0.4}{1.18}


Answer: V=0.34 mlV = 0.34 \text{ ml}

3. 2NaOH+H2SO4Na2SO4+H2O2NaOH + H_{2}SO_{4}\rightarrow Na_{2}SO_{4} + H_{2}O

n=V×Cn = V \times Cn=0.0155×0.220n = 0.0155 \times 0.220n=0.0341n = 0.0341n(NaOH)=0.0341×2n(NaOH) = 0.0341 \times 2n(NaOH)=0.0682n(NaOH) = 0.0682C=nVC = \frac{n}{V}C=0.06820.025C = \frac{0.0682}{0.025}C=0.27C = 0.27


Answer: 0.27 mol/L

4. (NH4)2S(NH_4)_2S

www.AssignmentExpert.com


LATEST TUTORIALS
APPROVED BY CLIENTS