Question #319959

8. Use the half-reaction method to balance the following equation and then identify the oxidizing and reducing agents:

Fe(OH)2 (s) + Pb(OH)3 -(aq) → Fe(OH)3 (s) + Pb(s) [basic]


Expert's answer

The given reaction is as follows

Pb(OH)3 - (aq) Pb(s)\longrightarrow Pb(s)


Fe(OH)2Fe(OH)3Fe(OH)_2 \longrightarrow Fe(OH)_3


Now balance other atom except O and H


Pb(OH)3 - (aq) Pb(s)+3H2O\longrightarrow Pb(s)+3H_2O


Fe(OH)2+H2OFe(OH)3Fe(OH)_2 + H_2O \longrightarrow Fe(OH)_3


Now balance H and H+ ions and add electrons

half balance reaction s

Pb(OH)3(aq)+3H++2ePb(s)+3H2OPb(OH)_3^- (aq) +3H^+ +2e^- \longrightarrow Pb(s) + 3H_2O


2Fe(OH)2+2H2O2Fe(OH)3+2H++2e2Fe(OH)_2 + 2H_2O \longrightarrow 2Fe(OH)_3 +2H^+ +2e^-


on combining both equation we get

Pb(OH)3(aq)+2Fe(OH)2Pb(s)+Fe(OH)3(s)+OH1(aq)Pb(OH)_3^- (aq) +2Fe(OH)_2 \longrightarrow Pb(s) + Fe(OH)_3(s) + OH^{-1} (aq)


oxidizing agent - Pb(OH)3-

reducing agent Fe(OH)2



Need a fast expert's response?

Submit order

and get a quick answer at the best price

for any assignment or question with DETAILED EXPLANATIONS!

LATEST TUTORIALS
APPROVED BY CLIENTS