Question #135568

⦁ What mass of CO is required to react with 25.13gn of Fe2O3 according to the chemical reaction below:

  Fe2O3  +    CO           Fe   + CO2

⦁ How many molecules of NH3 are produced by the reaction of 7 Mols of Ca(OH)2 according to the following. `

(NH4)2SO4 + Ca(OH)2    NH3 + CaSO4  +  H2O

⦁ Calculate the energy required to excite the hydrogen electron from n= 1 to n = 2. Also calculate the wavelength of light that must be absorbed by hydrogen atom in its ground state to reach this excited state.  



Expert's answer

I. The balanced reaction equation can be written as follows:

 Fe2O3  +    3CO      \rightarrow      2Fe   + 3CO2.

According to the stoichiometry of the reaction, 1 mol of Fe2O3 reacts with 3 mol of CO:

n(Fe2O3)=n(CO)3n(Fe_2O_3) = \frac{n(CO)}{3} .

The number of the moles of Fe2O3 in 25.13 g can be calculated using its molar mass MM =159.69 g/mol:

n(Fe2O3)=mM=25.13 g159.69 g/mol=0.1574n(Fe_2O_3) = \frac{m}{M} = \frac{\text{25.13 g}}{159.69 \text{ g/mol}} = 0.1574 mol.

Then, the number of the moles of CO that take part in the reaction is:

n(CO)=3n(Fe2O3)=30.1574=0.4721n(CO) = 3n(Fe_2O_3) = 3·0.1574 = 0.4721 mol.

Finally, the mass of CO is (the molar mass of CO is 28.01 g/mol):

m(CO)=Mn=28.01 g/mol0.4721 molm(CO) = M·n = 28.01\text{ g/mol}·0.4721\text{ mol}

 m(CO)=13.22m(CO) = 13.22 g.


II. Again, let's write the balanced reaction equation:

(NH4)2SO4 + Ca(OH)2 \rightarrow 2NH3 + CaSO4  +  2H2O.

As one can see, when 1 mol of Ca(OH)2 reacts, 2 mol of NH3 is produced:

n(Ca(OH)2)=n(NH3)2n(Ca(OH)_2) = \frac{n(NH_3)}{2} .

Therefore, the number of the moles of NH3 produced is the double of the number of the moles of calcium hydroxide that react:

n(NH3)=2n(Ca(OH)2)=14n(NH_3) = 2n(Ca(OH)_2) = 14 mol.

According to the definition of the mole, there are NA = 6.022·1023 constituent particles in 1 mol of the substance. Then, the number of the molecules of NH3 in 14 mol is:

N=nNA=146.0221023=8.431024N = n·N_A = 14·6.022·10^{23} = 8.43·10^{24} .


III. In order to calculate the energy of an electronic level nn in the atom of hydrogen, one may use the following formula:

E=E0n2E = -\frac{E_0}{n^2} , where E0=13.6E_0 = 13.6 eV.

Therefore, the energy difference between the level 1 and 2 is:

E2E1=E0(141)=13.63/4=10.2E_2 - E_1 = -E_0(\frac{1}{4} -1) = 13.6·3/4 = 10.2 eV.

The energy level n=1 is the lowest and is the ground state of the hydrogen atom. Therefore, the wavelength of light needed to be absorbed by the atom in order to be excited is simply the eV converted to nm:

λ=121.6\lambda = 121.6 nm.

The wavelength can also be calculated using Rydberg formula:

1λ=RH(1n121n22)\frac{1}{\lambda} = R_H (\frac{1}{n_1^2}-\frac{1}{n_2^2}) , where RH=1.09677583107R_H = 1.09677583·10^7 m-1 and which gives the same results.

Answer: I. 13.22 g, II. 8.43·1024 molecules, III. 10.2 eV and 121.6 nm.


Need a fast expert's response?

Submit order

and get a quick answer at the best price

for any assignment or question with DETAILED EXPLANATIONS!

LATEST TUTORIALS
APPROVED BY CLIENTS