Question #110534

A solution of hydrochloric acid has a pH of 1.8. A 1.0 g sample of sodium hydroxide is dissolved into 272.6 mL of this hydrochloric acid solution. Calculate the POH of the resulting solution, assuming no volume change

Expert's answer

HCl(aq)+NaOh(aq)=NaCl(aq)+H2O(l)HCl(aq) + NaOh (aq) = NaCl(aq) + H_2O (l)

1) moles of NaOH:

1.0gNaOH(1moleNaOH40.0gNaOH)=0.025molNaOH1.0 g NaOH (\frac{1 mole NaOH}{40.0 g NaOH})= 0.025 mol NaOH


2) moles of HCl

pH=log10[H+]pH = -log_{10}[H^+]

[H+]=10pH=101.8=0.01585mol/L[H^+]= 10^{-pH} = 10^{-1.8} = 0.01585 mol/L


272.6mL(1L1000mL)(0.01585molHCl1L)=0.004321mol272.6 mL (\frac{1 L}{1000mL})(\frac{0.01585 mol HCl}{1 L})=0.004321 mol


3) As mole ratio n(HCl):n(NaOH) = 1:1, then moles of both NaOh and HCl consumed in the reaction are the same. As limiting reactant is HCl (0.004321<0.025), then 0.004321 moles of NaOH were consumed in the reaction.

Moles of NaOH left:

n(NaOH)=0.0250.004321=0.02068moln(NaOH) = 0.025-0.004321 = 0.02068 mol

concentration of NaOH solution is:

c(NaOH)=molesNaOhvolumeofsolution=0.02068mol0.2726L=0.07586mol/Lc(NaOH) = \frac{moles NaOh}{volume of solution} = \frac{0.02068 mol}{0.2726L}=0.07586 mol/L


4) pOH=log10[OH]=log10(0.07586)=1.1pOH = -log_{10}[OH^-]= -log_{10}(0.07586)= 1.1



LATEST TUTORIALS
APPROVED BY CLIENTS