Amphoteric hydroxides are chemicals that can exhibit both basic and acidic properties (depending on reaction conditions). Amphoteric hydroxides behave as bases in an acidic environment, and as acids in an alkaline environment. Amphoteric hydroxides include bases formed by transition metals: Al (3+), Be (2+), Fe (3+), Cr (3+), Zn (2+), Sn (2+), Pb (2+ ) other. Almost all of them are insoluble in water, are weak electrolytes.
When heated, the compounds decompose.
a) Cr(OH)3 + 3HCl -> CrCl3 + 3H2O
Cr(OH)3+3H(+)+3Cl(-)=Cr(3+)+3CL(-)+3H2O
Cr(OH)3+3H(+)=Cr(3+)+3H2O
Cr(OH)3 + 3NaOH -> Na3[Cr(OH)6]
Cr(OH)3+ 3Na(+ )+3OH(-)= 3Na(+)+{ Cr(OH)6}(3-)
Cr(OH)3+3OH(-)={ Cr(OH)6}(3-)
b) Al(OH)3 + 3HCl-> AlCl3 +3H2O
Al(OH)3+3H(+)+3Cl(-)=Al3(+)+3CL(-)+3H2O
Al(OH)3+3H(+)=Al(3+)+3H2O
Al(OH)3+ 3NaOH-> Na3AlO3+ 3H2O
Al(OH)3+ 3Na(+) +3OH(-)= 3Na(+)+ AlO3(3-)+ 3H2O
Al(OH)3+3OH(-)=AlO3(3-)+ 3H2O
These are cations 4 of the analytical group.